missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Inosine, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC122252500
Specifications
| 1.65 to 1.77 (A250/A260), 0.22 to 0.26 (A280/A260) | |
| Authentic | |
| Glass bottle | |
| -49.2 | |
| 0.1% max. | |
| White | |
| 250g | |
| 98.5% min. (HPLC) | |
| MFCD00066770 | |
| 15, 5018 | |
| Solubility in water: 2.1g/100 mL (20°C). Other solubilities: soluble in ethanol | |
| C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)CO)O)O | |
| 268.22 | |
| CHEBI:17596 | |
| Crystalline Powder |
| Inosine | |
| 1% max. | |
| − 49.20 (18.00°C c=1,H2O) | |
| 98 to 102% (lambda max. 248.5nm,pH 7) Molar absorptivity 12200+/-2%,on dry substance | |
| 98% min. (c=1, H2O, 430nm, 1cm cell) | |
| 212°C to 213°C | |
| 58-63-9 | |
| C10H12N4O5 | |
| 31, 25 | |
| atorel, hypoxanthine riboside, hypoxanthosine, inosine, oxiamin, panholic-l, pantholic-l, ribonosine, selfer, trophicardyl | |
| UGQMRVRMYYASKQ-KQYNXXCUSA-N | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one | |
| 6021 | |
| 268.22 | |
| 99% |
Chemical Identifiers
| 58-63-9 | |
| 268.22 | |
| UGQMRVRMYYASKQ-KQYNXXCUSA-N | |
| 6021 | |
| 9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-one |
| C10H12N4O5 | |
| MFCD00066770 | |
| atorel, hypoxanthine riboside, hypoxanthosine, inosine, oxiamin, panholic-l, pantholic-l, ribonosine, selfer, trophicardyl | |
| CHEBI:17596 | |
| C1=NC(=O)C2=C(N1)N(C=N2)C3C(C(C(O3)CO)O)O |
Safety and Handling
EINECSNumber : 200-390-4