missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Indole-3-butyric acid, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210204205
Specifications
| Indole-3-butyric acid | |
| 133-32-4 | |
| C12H13NO2 | |
| 5 g | |
| JTEDVYBZBROSJT-UHFFFAOYSA-N | |
| 4-(1H-indol-3-yl)butanoic acid | |
| 8617 | |
| 203.24 |
| Plant growth hormone | |
| White | |
| MFCD00005664 | |
| indole-3-butyric acid, 3-indolebutyric acid, 4-1h-indol-3-yl butanoic acid, indolebutyric acid, hormodin, 1h-indole-3-butanoic acid, seradix, indole-3-butanoic acid, jiffy grow, 4-indol-3-yl butyric acid | |
| C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O | |
| 203.241 | |
| CHEBI:33070 | |
| Powder |
Chemical Identifiers
| 133-32-4 | |
| 203.241 | |
| JTEDVYBZBROSJT-UHFFFAOYSA-N | |
| 8617 | |
| 4-(1H-indol-3-yl)butanoic acid |
| C12H13NO2 | |
| MFCD00005664 | |
| indole-3-butyric acid, 3-indolebutyric acid, 4-1h-indol-3-yl butanoic acid, indolebutyric acid, hormodin, 1h-indole-3-butanoic acid, seradix, indole-3-butanoic acid, jiffy grow, 4-indol-3-yl butyric acid | |
| CHEBI:33070 | |
| C1=CC=C2C(=C1)C(=CN2)CCCC(=O)O |
Safety and Handling
EINECSNumber : 205-101-5
Recommended Storage : Store at +4°C