missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Hexafluorobenzene, 99%, ACROS Organics™
$117.67 - $117.67
Chemical Identifiers
| CAS | 392-56-3 |
|---|---|
| Molecular Formula | C6F6 |
| Molecular Weight (g/mol) | 186.06 |
| MDL Number | MFCD00000288 |
| InChI Key | ZQBFAOFFOQMSGJ-UHFFFAOYSA-N |
| Synonym | acmc-1bmus, benzene, 1,2,3,4,5,6-hexafluoro, benzene, hexafluoro, hexa fluorobenzene, hexafluorbenzol, hexafluoro benzene, hexafluorobenzene, perfluorobenzene, pubchem18879, unii-cmc18t611k |
| PubChem CID | 9805 |
| ChEBI | CHEBI:38589 |
| IUPAC Name | 1,2,3,4,5,6-hexafluorobenzene |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC120540100
|
Thermo Fisher Scientific
120540100 |
10mL | Glass bottle |
Each for $117.67
|
|
AC120541000
|
Thermo Fisher Scientific
AC120541000 |
100mL | Glass bottle |
N/A
|
N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
|
AC120545000
|
Thermo Fisher Scientific
AC120545000 |
500mL | Glass Bottle |
N/A
|
N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 392-56-3 | |
| 186.06 | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 9805 | |
| 1,2,3,4,5,6-hexafluorobenzene |
| C6F6 | |
| MFCD00000288 | |
| acmc-1bmus, benzene, 1,2,3,4,5,6-hexafluoro, benzene, hexafluoro, hexa fluorobenzene, hexafluorbenzol, hexafluoro benzene, hexafluorobenzene, perfluorobenzene, pubchem18879, unii-cmc18t611k | |
| CHEBI:38589 | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F |
Specifications
| 1.6120g/mL | |
| Authentic | |
| 1.3760 to 1.3780 | |
| 81.0°C to 82.0°C (743.0mmHg) | |
| 3.7°C to 4.1°C | |
| 392-56-3 | |
| C6F6 | |
| MFCD00000288 | |
| acmc-1bmus, benzene, 1,2,3,4,5,6-hexafluoro, benzene, hexafluoro, hexa fluorobenzene, hexafluorbenzol, hexafluoro benzene, hexafluorobenzene, perfluorobenzene, pubchem18879, unii-cmc18t611k | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 1,2,3,4,5,6-hexafluorobenzene | |
| 9805 | |
| 186.06 | |
| 99% |
| 10°C | |
| Glass bottle | |
| 1.612 | |
| Colorless to Yellow | |
| 10mL | |
| 98.5% min. (GC) | |
| C6F6 | |
| 15,4722 | |
| Solubility in water: immiscible. Other solubilities: soluble in ethanol | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F | |
| 186.06 | |
| CHEBI:38589 | |
| Liquid | |
| Hexafluorobenzene |
Safety and Handling
GHS H Statement
Highly flammable liquid and vapor.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Ground/Bond container and receiving equipment.
GHS Signal Word: Danger
EINECSNumber : 206-876-2