missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Hexafluorobenzene, 99%, ACROS Organics™
$104.98 - $104.98
Chemical Identifiers
| CAS | 392-56-3 |
|---|---|
| Molecular Formula | C6F6 |
| Molecular Weight (g/mol) | 186.056 |
| MDL Number | MFCD00000288 |
| InChI Key | ZQBFAOFFOQMSGJ-UHFFFAOYSA-N |
| Synonym | hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus |
| PubChem CID | 9805 |
| ChEBI | CHEBI:38589 |
| IUPAC Name | 1,2,3,4,5,6-hexafluorobenzene |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)F)F |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC120540100 SDS |
Acros Organics
120540100 |
10mL | Glass bottle |
Each for $104.98
|
|
AC120541000 SDS |
Acros Organics
AC120541000 |
100mL | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC120545000 SDS |
Acros Organics
AC120545000 |
500mL | Glass Bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 392-56-3 | |
| 186.056 | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 9805 | |
| 1,2,3,4,5,6-hexafluorobenzene |
| C6F6 | |
| MFCD00000288 | |
| hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus | |
| CHEBI:38589 | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F |
Specifications
| 1.6120g/mL | |
| Authentic | |
| 1.3760 to 1.3780 | |
| 81.0°C to 82.0°C (743.0mmHg) | |
| 3.7°C to 4.1°C | |
| 392-56-3 | |
| C6F6 | |
| MFCD00000288 | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 1,2,3,4,5,6-hexafluorobenzene | |
| 9805 | |
| 186.06 | |
| 99% |
| 10°C | |
| Glass bottle | |
| 1.612 | |
| Colorless to Yellow | |
| 10mL | |
| 99% | |
| C6F6 | |
| hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F | |
| 186.056 | |
| CHEBI:38589 | |
| Liquid | |
| Hexafluorobenzene |
Safety and Handling
GHS P Statement Highly flammable liquid and vapor.
GHS P Statement Keep away from heat/sparks/open flames/hot surfaces. - No smoking. Ground/Bond container and receiving equipment.
Danger