missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Guaiazulene, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC120200100
Specifications
| Guaiazulene | |
| >110°C | |
| Glass bottle | |
| 153.0°C (7.0 Torr) | |
| 29.0°C to 31.0°C | |
| 489-84-9 | |
| C15H18 | |
| 15,459 | |
| Solubility in water: 25%. Other solubilities: soluble in ethanol, ethyl ether and ethyl acetate | |
| CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C | |
| 198.31 | |
| CHEBI:5550 | |
| Low Melting Crystalline Solid |
| 0.9700g/mL | |
| Authentic | |
| 0.97 | |
| Blue | |
| 10g | |
| 98.5% min. (GC) | |
| 05,II,473 | |
| 1,4-dimethyl-7-isopropylazulene, 7-isopropyl-1,4-dimethylazulene, azulon, azunol, eucazulen, guaiazulene, guajazulene, kessazulen, purazulen, vetivazulen | |
| FWKQNCXZGNBPFD-UHFFFAOYSA-N | |
| 1,4-dimethyl-7-propan-2-ylazulene | |
| 3515 | |
| 198.31 | |
| 99% |
Chemical Identifiers
| 489-84-9 | |
| 198.31 | |
| 1,4-dimethyl-7-isopropylazulene, 7-isopropyl-1,4-dimethylazulene, azulon, azunol, eucazulen, guaiazulene, guajazulene, kessazulen, purazulen, vetivazulen | |
| CHEBI:5550 | |
| CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C |
| C15H18 | |
| FWKQNCXZGNBPFD-UHFFFAOYSA-N | |
| 3515 | |
| 1,4-dimethyl-7-propan-2-ylazulene |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 207-701-2