missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Glutathione Reduced, Fisher BioReagents
Supplier: Fisher BioReagents BP2521100
Description
Glutathione is a useful tripeptide involved in many aspects of metabolism, including transport of γ-glutamyl amino acids and reductive cleavage of disulfide bonds.Specifications
| Glutathione Reduced | |
| 182°C | |
| 3 | |
| Report % | |
| Amber Glass | |
| 100 g | |
| -21 to -11° (+ or -) | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
| 124886 | |
| 307.3 | |
| Powder or Solid |
| 70-18-8 | |
| White | |
| 0.01% max. | |
| ≥98 % | |
| C10H17N3O6S | |
| 15, 4511 | |
| glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
| 307.321 | |
| CHEBI:16856 | |
| ≥98% |
Chemical Identifiers
| 70-18-8 | |
| 307.321 | |
| glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
| CHEBI:16856 | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| C10H17N3O6S | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| 124886 | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
Safety and Handling
Recommended Storage : 4°C