missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Glutathione, 98%, for analysis, reduced, ACROS Organics™
$30.68 - $2,227.92
Chemical Identifiers
| CAS | 70-18-8 |
|---|---|
| Molecular Formula | C10H17N3O6S |
| Molecular Weight (g/mol) | 307.321 |
| MDL Number | MFCD00065939 |
| InChI Key | RWSXRVCMGQZWBV-WDSKDSINSA-N |
| Synonym | deltathione |
| PubChem CID | 124886 |
| ChEBI | CHEBI:16856 |
| IUPAC Name | (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
| AC120000010 SDS |
Acros Organics
120000010 |
1g |
Each for $30.68
|
|
AC120000050 SDS |
Acros Organics
120000050 |
5g |
Each for $65.25
|
|
AC120000250 SDS |
Acros Organics
120000250 |
25g |
Each for $185.75
|
|
AC120001000 SDS |
Acros Organics
AC120001000 |
100g |
Each for $579.35
|
|
AC120005000 SDS |
Acros Organics
AC120005000 |
500g |
Each for $2,227.92
|
|
Chemical Identifiers
| 70-18-8 | |
| 307.321 | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| 124886 | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| C10H17N3O6S | |
| MFCD00065939 | |
| deltathione | |
| CHEBI:16856 | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
Specifications
| Authentic | |
| Glass bottle | |
| − 16.50 | |
| White | |
| 1g | |
| 98% | |
| MFCD00065939 | |
| Solubility in water: very soluble. Other solubilities: freely soluble in dilute alcohol and dimethyl-, formamide, almost insoluble in ethanol | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
| 307.321 | |
| CHEBI:16856 | |
| Crystalline Powder | |
| Analysis |
| 0.5% max. (105°C, 3 hrs) | |
| − 16.50 (20.00°C c=2,H2O) | |
| 0.1% max. (800°C) | |
| 182.0°C to 192.0°C | |
| 70-18-8 | |
| C10H17N3O6S | |
| deltathione | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
| 124886 | |
| 307.32 | |
| 98% | |
| Glutathione, For analysis, Reduced |