missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Glutathione, 98%, for analysis, reduced, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC120001000
Specifications
| Glutathione | |
| 0.5% max. (105°C, 3 hrs) | |
| − 16.50 (20.00°C c=2,H2O) | |
| 0.1% max. (800°C) | |
| 182.0°C to 192.0°C | |
| For analysis, Reduced | |
| 97.5% min. (Iodimetry) | |
| MFCD00065939 | |
| 15,4511 | |
| Solubility in water: very soluble. Other solubilities: freely soluble in dilute alcohol and dimethyl-, formamide, almost insoluble in ethanol | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
| 307.32 | |
| CHEBI:16856 | |
| Crystalline Powder | |
| Analysis |
| Authentic | |
| Glass bottle | |
| − 16.50 | |
| White | |
| 100g | |
| 70-18-8 | |
| C10H17N3O6S | |
| 04,II,931 | |
| deltathione, glutathion, glutathione, glutathione-sh, glutinal, isethion, l-glutathione, neuthion, reduced glutathione, tathion | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
| 124886 | |
| 307.32 | |
| 98% |
Chemical Identifiers
| 70-18-8 | |
| 307.32 | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| 124886 | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| C10H17N3O6S | |
| MFCD00065939 | |
| deltathione, glutathion, glutathione, glutathione-sh, glutinal, isethion, l-glutathione, neuthion, reduced glutathione, tathion | |
| CHEBI:16856 | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
Safety and Handling
EINECSNumber : 200-725-4