missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Gluconic acid, sodium salt, 98%, Thermo Scientific Chemicals
Supplier: Thermo Scientific Chemicals 181390025
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Gluconic acid, sodium salt | |
| 206.0°C to 209.0°C | |
| 6.5 to 7.5 (10% soln.) | |
| 0.98 | |
| C6H11NaO7 | |
| MFCD00064210 | |
| 03, I, 188 | |
| + 12.10 (23.00°C c=1.75,H2O) | |
| sodium gluconate, sodium d-gluconate, d-gluconic acid sodium salt, d-gluconic acid, monosodium salt, gluconic acid sodium salt, monosodium gluconate, glonsen, monosodium d-gluconate, gluconate sodium, pasexon 100t | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] | |
| 218.137 | |
| CHEBI:84997 | |
| 0.98 |
| 527-07-1 | |
| White to Beige | |
| Authentic | |
| Plastic Bottle | |
| HOCH2[CH(OH)]4CO2Na | |
| 2.5 kg | |
| 15, 4492 | |
| + 12.10 | |
| UPMFZISCCZSDND-JJKGCWMISA-M | |
| sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate | |
| 23672301 | |
| 218.14 | |
| Crystalline Powder |
Chemical Identifiers
| 527-07-1 | |
| 218.137 | |
| UPMFZISCCZSDND-JJKGCWMISA-M | |
| 23672301 | |
| sodium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| C6H11NaO7 | |
| MFCD00064210 | |
| sodium gluconate, sodium d-gluconate, d-gluconic acid sodium salt, d-gluconic acid, monosodium salt, gluconic acid sodium salt, monosodium gluconate, glonsen, monosodium d-gluconate, gluconate sodium, pasexon 100t | |
| CHEBI:84997 | |
| C(C(C(C(C(C(=O)[O-])O)O)O)O)O.[Na+] |
RUO – Research Use Only