missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Giemsa Stain (Powder/Certified Biological Stain), Fisher Chemical™
Manufacturer: Fisher Chemical G14610
Specifications
| Giemsa Stain | |
| Pass Test | |
| MFCD00081642 | |
| NALREUIWICQLPS-UHFFFAOYSA-N | |
| (7-aminophenothiazin-3-ylidene)-dimethylazanium;chloride | |
| 13735 | |
| Certified Biological Stain | |
| 300°C | |
| 10g |
| 51811-82-6 | |
| C14H14ClN3S | |
| Pass Test | |
| C[N+](=C1C=CC2=NC3=C(C=C(C=C3)N)SC2=C1)C.[Cl-] | |
| 291.797 | |
| Solid | |
| Glass Bottle | |
| Green |
Chemical Identifiers
| 51811-82-6 | |
| 291.797 | |
| NALREUIWICQLPS-UHFFFAOYSA-N | |
| (7-aminophenothiazin-3-ylidene)-dimethylazanium;chloride |
| C14H14ClN3S | |
| MFCD00081642 | |
| 13735 | |
| C[N+](=C1C=CC2=NC3=C(C=C(C=C3)N)SC2=C1)C.[Cl-] |
Safety and Handling