missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Gentian Violet, 2% (w/v) in Methanol, Ricca Chemical
Supplier: Ricca Chemical Company 32354
Specifications
| Gentian Violet | |
| 96.0,2.43 | |
| 2% (w/v) | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride | |
| 11057 | |
| Natural Poly Bottle | |
| Violet | |
| Liquid |
| 548-62-9,67-56-1 | |
| 99.0,2.53 | |
| C25H30ClN3 | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] | |
| 407.986 | |
| CHEBI:41688 | |
| Methanolic Solution | |
| 120 mL |
Chemical Identifiers
| 548-62-9 | |
| 407.986 | |
| 11057 | |
| [4-[bis[4-(dimethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;chloride |
| C25H30ClN3 | |
| ZXJXZNDDNMQXFV-UHFFFAOYSA-M | |
| CHEBI:41688 | |
| CN(C)C1=CC=C(C=C1)C(=C2C=CC(=[N+](C)C)C=C2)C3=CC=C(C=C3)N(C)C.[Cl-] |