missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Genistein, 99%, synthetic, ACROS Organics™
$155.11 - $451.28
Chemical Identifiers
| CAS | 446-72-0 |
|---|---|
| Molecular Formula | C15H10O5 |
| Molecular Weight (g/mol) | 270.24 |
| MDL Number | MFCD00016952 |
| InChI Key | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Synonym | genistein, prunetol, genisteol, 4',5,7-trihydroxyisoflavone, genisterin, sophoricol, 5,7,4'-trihydroxyisoflavone, bonistein, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, genestein |
| PubChem CID | 5280961 |
| ChEBI | CHEBI:28088 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC328271000 SDS |
Acros Organics
AC328271000 |
100mg | Glass bottle |
Each for $451.28
|
|
AC328270250 SDS |
Acros Organics
328270250 |
25mg | Glass bottle |
Each for $155.11
|
|
Chemical Identifiers
| 446-72-0 | |
| 270.24 | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5280961 | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| C15H10O5 | |
| MFCD00016952 | |
| genistein, prunetol, genisteol, 4',5,7-trihydroxyisoflavone, genisterin, sophoricol, 5,7,4'-trihydroxyisoflavone, bonistein, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, genestein | |
| CHEBI:28088 | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
Specifications
| Authentic | |
| White to Beige | |
| 100mg | |
| 99% | |
| MFCD00016952 | |
| genistein, prunetol, genisteol, 4',5,7-trihydroxyisoflavone, genisterin, sophoricol, 5,7,4'-trihydroxyisoflavone, bonistein, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, genestein | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one | |
| 5280961 | |
| 270.2 | |
| 99% |
| Glass bottle | |
| 297.0°C to 298.0°C | |
| 446-72-0 | |
| C15H10O5 | |
| 15, 4426 | |
| Solubility in water: insoluble in water. Other solubilities: soluble in dmso and ethanol, soluble in usual organic solvents, soluble in diluted alkalies with yellow color | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O | |
| 270.24 | |
| CHEBI:28088 | |
| Crystalline Powder | |
| Genistein, Synthetic |