missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Genistein, 99%, synthetic, ACROS Organics™
$168.86 - $484.44
Chemical Identifiers
| CAS | 446-72-0 |
|---|---|
| Molecular Formula | C15H10O5 |
| Molecular Weight (g/mol) | 270.2 |
| MDL Number | MFCD00016952 |
| InChI Key | TZBJGXHYKVUXJN-UHFFFAOYSA-N |
| Synonym | 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol |
| PubChem CID | 5280961 |
| ChEBI | CHEBI:28088 |
| IUPAC Name | 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| SMILES | C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC328270250
|
Fisher Scientific Acros
328270250 |
25mg | Glass bottle |
Each for $168.86
|
|
AC328271000
|
Thermo Fisher Scientific
AC328271000 |
100mg | Glass bottle |
Each for $484.44
|
|
Chemical Identifiers
| 446-72-0 | |
| 270.2 | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5280961 | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| C15H10O5 | |
| MFCD00016952 | |
| 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol | |
| CHEBI:28088 | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
Specifications
| Authentic | |
| White to Beige | |
| 25mg | |
| 98.5% min. (HPLC) | |
| MFCD00016952 | |
| 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one | |
| 5280961 | |
| 270.2 | |
| 99% |
| Glass bottle | |
| 297.0°C to 298.0°C | |
| 446-72-0 | |
| C15H10O5 | |
| 15, 4426 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in dmso and ethanol,soluble in usual organic solvents,soluble in diluted alkalies with yellow color | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O | |
| 270.2 | |
| CHEBI:28088 | |
| Crystalline Powder | |
| Genistein, Synthetic |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS Signal Word: Warning
EINECSNumber : 207-174-9