missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Genistein, 99%, synthetic, ACROS Organics™
Manufacturer: Fisher Scientific Acros 328270250
Specifications
| Genistein | |
| Glass bottle | |
| 297.0°C to 298.0°C | |
| Synthetic | |
| 98.5% min. (HPLC) | |
| MFCD00016952 | |
| 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one | |
| 5280961 | |
| 270.2 | |
| 99% |
| Authentic | |
| White to Beige | |
| 25mg | |
| 446-72-0 | |
| C15H10O5 | |
| 15, 4426 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in dmso and ethanol,soluble in usual organic solvents,soluble in diluted alkalies with yellow color | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O | |
| 270.2 | |
| CHEBI:28088 | |
| Crystalline Powder |
Chemical Identifiers
| 446-72-0 | |
| 270.2 | |
| TZBJGXHYKVUXJN-UHFFFAOYSA-N | |
| 5280961 | |
| 5,7-dihydroxy-3-(4-hydroxyphenyl)chromen-4-one |
| C15H10O5 | |
| MFCD00016952 | |
| 4',5,7-trihydroxyisoflavone, 5,7,4'-trihydroxyisoflavone, 5,7-dihydroxy-3-4-hydroxyphenyl-4h-chromen-4-one, bonistein, genestein, genistein, genisteol, genisterin, prunetol, sophoricol | |
| CHEBI:28088 | |
| C1=CC(=CC=C1C2=COC3=CC(=CC(=C3C2=O)O)O)O |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS Signal Word: Warning
EINECSNumber : 207-174-9