missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Fluoro-N,N,N',N'-tetramethylformamidinium hexafluorophosphate, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC434960050
Description
Coupling reagentSpecifications
| Fluoro-N,N,N′,N′-tetramethylformamidinium hexafluorophosphate | |
| Glass bottle | |
| 107°C to 110°C | |
| 164298-23-1 | |
| C5H12FN2·F6P | |
| acmc-209dqu, c5h12fn2.f6p, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate, n,n,n',n'-tetramethylfluoroformamidinium hexafluorophosphate, n-dimethylamino fluoromethylene-n-methylmethanaminium hexafluorophosphate v, tetramethyl fluoroformamidium hexafluoro phosphate, tetramethyl fluoroformamidium hexafluorophosphate, tetramethylfluoroformamidinium hexafluorophosphate, tffh, tffh, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate | |
| CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F | |
| 264.13 | |
| 264.13 | |
| 99% |
| Authentic | |
| Yellow | |
| 5g | |
| 98.5% min. (HPLC) | |
| MFCD02684443 | |
| ZAVXOOLKAGPJPI-UHFFFAOYSA-N | |
| [dimethylamino(fluoro)methylidene]-dimethylazanium;hexafluorophosphate | |
| 2774761 | |
| Powder |
Chemical Identifiers
| 164298-23-1 | |
| 264.13 | |
| ZAVXOOLKAGPJPI-UHFFFAOYSA-N | |
| 2774761 | |
| CN(C)C(=[N+](C)C)F.F[P-](F)(F)(F)(F)F |
| C5H12FN2·F6P | |
| MFCD02684443 | |
| acmc-209dqu, c5h12fn2.f6p, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate, n,n,n',n'-tetramethylfluoroformamidinium hexafluorophosphate, n-dimethylamino fluoromethylene-n-methylmethanaminium hexafluorophosphate v, tetramethyl fluoroformamidium hexafluoro phosphate, tetramethyl fluoroformamidium hexafluorophosphate, tetramethylfluoroformamidinium hexafluorophosphate, tffh, tffh, fluoro-n,n,n',n'-tetramethylformamidinium hexafluorophosphate | |
| [dimethylamino(fluoro)methylidene]-dimethylazanium;hexafluorophosphate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for
GHS Signal Word: Warning