Learn More
Ethylenediaminetetraacetic acid, 99%, pure, ACROS Organics™
Manufacturer: Acros Organics 118430010
Specifications
| Ethylenediaminetetraacetic acid | |
| Authentic | |
| White | |
| 1kg | |
| 60-00-4 | |
| C10H16N2O8 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
| 6049 | |
| 292.23 | |
| 99% |
| >100°C | |
| Plastic bottle | |
| 220.0°C | |
| ~2 to 3 (sat. soln. aq. soln.) | |
| 99% | |
| (HO2CCH2)2NCH2CH2N(CH2CO2H)2 | |
| Solubility in water: 0.5g/L (20°C) - 2.2g/L (80°C). Other solubilities: insoluble in common organic solvents, insoluble in dilute ammonium hydroxide: 0.005% max | |
| C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 292.244 | |
| CHEBI:42191 | |
| Fine Crystalline Powder | |
| Pure |
Chemical Identifiers
| 60-00-4 | |
| 292.244 | |
| edta, edetic acid, ethylenediaminetetraacetic acid, edathamil, versene, endrate, havidote, titriplex, edta acid, sequestrol | |
| CHEBI:42191 | |
| C(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| C10H16N2O8 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
Safety and Handling
GHS H Statement:
Causes serious eye irritation.
Harmful if inhaled.
GHS P Statement:
Wash face, hands and any exposed skin thoroughly after handling.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
If eye irritation persists: Get medical advice/attention.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.