missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethylenediaminetetraacetic acid, 99%, pure, ACROS Organics™
Manufacturer: Fisher Scientific Acros 118430010
Specifications
| Ethylenediaminetetraacetic acid | |
| Authentic | |
| White | |
| 1kg | |
| 60-00-4 | |
| C10H16N2O8 | |
| MFCD00003541 | |
| 15,3565 | |
| Solubility in water: 0.5g/L (20°C) - 2.2g/L (80°C). Other solubilities: insoluble in common organic solvents, insoluble in dilute ammonium hydroxide: 0.005% max | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O | |
| 292.24 | |
| CHEBI:42191 | |
| Fine Crystalline Powder | |
| Pure |
| >100°C | |
| Plastic bottle | |
| 220.0°C | |
| ~2 to 3 (sat. soln. aq. soln.) | |
| 98.5% min. (Complexometry) | |
| (HO2CCH2)2NCH2CH2N(CH2CO2H)2 | |
| 01,373 | |
| edathamil, edetic acid, edta, edta acid, endrate, ethylenediaminetetraacetic acid, havidote, sequestrol, titriplex, versene | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid | |
| 6049 | |
| 292.23 | |
| 99% |
Chemical Identifiers
| 60-00-4 | |
| 292.24 | |
| KCXVZYZYPLLWCC-UHFFFAOYSA-N | |
| 6049 | |
| 2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid |
| C10H16N2O8 | |
| MFCD00003541 | |
| edathamil, edetic acid, edta, edta acid, endrate, ethylenediaminetetraacetic acid, havidote, sequestrol, titriplex, versene | |
| CHEBI:42191 | |
| OC(=O)CN(CCN(CC(O)=O)CC(O)=O)CC(O)=O |
Safety and Handling
GHS H Statement
Causes serious eye irritation.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing.
IF INHALED: Remove to fresh air and keep at rest in a position comfortable for breathing.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF IN EYES: Rinse cau
GHS Signal Word: Warning
EINECSNumber : 200-449-4