missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
ethyle2-amino-4-(4-bromophenyl)-3-thiophenecarboxylate, 97%, Maybridge™
Manufacturer: Fisher Scientific Company CC00243DA
Specifications
| Ethyl 2-amino-4-(4-bromophenyl)-3-thiophenecarboxylate | |
| 1g | |
| 96.5 | |
| 97% | |
| MFCD00435056 | |
| SEWFWRCESBYGFS-UHFFFAOYSA-N | |
| ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate | |
| 727636 | |
| 97% |
| Amber Glass Bottle | |
| 306934-99-6 | |
| 100.0 | |
| C13H12BrNO2S | |
| 2-amino-4-4-bromo-phenyl-thiophene-3-carboxylic acid ethyl ester, 2-amino-4-4-bromophenyl-3-ethoxycarbonyl thiophene, 2-amino-4-4-bromophenyl-thiophene-3-carboxylic acid ethyl ester, ethyl 2-amino-4-4-bromo-phenyl-thiophene-3-carboxylate, ethyl 2-amino-4-4-bromophenyl thiophene-3-carboxylate, ethyl 2-amino-4-4-bromophenyl-3-thiophene carboxylate, ethyl 2-amino-4-4-bromophenyl-3-thiophenecarboxylate, ethyl2-amino-4-4-bromophenyl thiophene-3-carboxylate, ethyl2-amino-4-4-bromophenyl-3-thiophenecarboxylate | |
| CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)Br)N | |
| 326.208 | |
| 326.21 |
Chemical Identifiers
| 306934-99-6 | |
| 326.208 | |
| SEWFWRCESBYGFS-UHFFFAOYSA-N | |
| 727636 | |
| CCOC(=O)C1=C(SC=C1C2=CC=C(C=C2)Br)N |
| C13H12BrNO2S | |
| MFCD00435056 | |
| 2-amino-4-4-bromo-phenyl-thiophene-3-carboxylic acid ethyl ester, 2-amino-4-4-bromophenyl-3-ethoxycarbonyl thiophene, 2-amino-4-4-bromophenyl-thiophene-3-carboxylic acid ethyl ester, ethyl 2-amino-4-4-bromo-phenyl-thiophene-3-carboxylate, ethyl 2-amino-4-4-bromophenyl thiophene-3-carboxylate, ethyl 2-amino-4-4-bromophenyl-3-thiophene carboxylate, ethyl 2-amino-4-4-bromophenyl-3-thiophenecarboxylate, ethyl2-amino-4-4-bromophenyl thiophene-3-carboxylate, ethyl2-amino-4-4-bromophenyl-3-thiophenecarboxylate | |
| ethyl 2-amino-4-(4-bromophenyl)thiophene-3-carboxylate |