Learn More
Ethyl oleate, tech. 70%
CAS: 111-62-6 | C20H38O2 | 310.522 g/mol
Supplier: Thermo Scientific Chemicals A156010I
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Ethyl oleate | |
| -32°C | |
| 205°C to 208°C | |
| C20H38O2 | |
| CH3(CH2)7CH=CH(CH2)7CO2CH2CH3 | |
| 5000 g | |
| Air Sensitive | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| ethyl (Z)-octadec-9-enoate | |
| 5363269 | |
| 310.53 | |
| Technical |
| 111-62-6 | |
| 0.87 | |
| >110°C (230°F) | |
| 1.451 | |
| MFCD00009579 | |
| 1727318 | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC | |
| 310.522 | |
| CHEBI:84940 | |
| 70% |
Chemical Identifiers
| 111-62-6 | |
| 310.522 | |
| LVGKNOAMLMIIKO-QXMHVHEDSA-N | |
| 5363269 | |
| ethyl (Z)-octadec-9-enoate |
| C20H38O2 | |
| MFCD00009579 | |
| ethyl oleate, ethyl cis-9-octadecenoate, oleic acid, ethyl ester, oleic acid ethyl ester, 9-octadecenoic acid z-, ethyl ester, ethyl oleate nf, ethyl z-octadec-9-enoate, ethyl oleate natural, fema no. 2450 | |
| CHEBI:84940 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC |
Safety and Handling
EINECSNumber : 203-889-5
RTECSNumber : RG3715000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only