missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl N-(tert-Butoxycarbonyl)-L-pyroglutamate 97.0+%, TCI America™
Supplier: TCI America E11351G
Specifications
| Ethyl N-(tert-Butoxycarbonyl)-L-pyroglutamate | |
| 54°C | |
| C12H19NO5 | |
| 1 g | |
| YWWWGFSJHCFVOW-UHFFFAOYNA-N | |
| 1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate | |
| 5461186 | |
| ≥97.0% (HPLC,N) |
| 144978-12-1 | |
| White | |
| MFCD07778090 | |
| boc-pyr-oet, s-ethyl-n-boc-pyroglutamate, n-boc-l-pyroglutamic acid ethyl ester, 1-boc-l-pyroglutamic acid ethyl ester, boc-l-pyroglutamic acid ethyl ester, s-1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate, ethyl n-boc-l-pyroglutamate, 1-tert-butyl 2-ethyl 2s-5-oxopyrrolidine-1,2-dicarboxylate, s-n-alpha-t-butyloxycarbonyl-pyroglutamic acid ethyl ester, 1-tert-butyl 2-ethyl s-5-oxopyrrolidine-1,2-dicarboxylate | |
| CCOC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C | |
| 257.29 | |
| 257.29 | |
| Crystalline Powder |
Chemical Identifiers
| 144978-12-1 | |
| 257.29 | |
| YWWWGFSJHCFVOW-UHFFFAOYNA-N | |
| 5461186 | |
| CCOC(=O)C1CCC(=O)N1C(=O)OC(C)(C)C |
| C12H19NO5 | |
| MFCD07778090 | |
| boc-pyr-oet, s-ethyl-n-boc-pyroglutamate, n-boc-l-pyroglutamic acid ethyl ester, 1-boc-l-pyroglutamic acid ethyl ester, boc-l-pyroglutamic acid ethyl ester, s-1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate, ethyl n-boc-l-pyroglutamate, 1-tert-butyl 2-ethyl 2s-5-oxopyrrolidine-1,2-dicarboxylate, s-n-alpha-t-butyloxycarbonyl-pyroglutamic acid ethyl ester, 1-tert-butyl 2-ethyl s-5-oxopyrrolidine-1,2-dicarboxylate | |
| 1-tert-butyl 2-ethyl 5-oxopyrrolidine-1,2-dicarboxylate |
Safety and Handling
TSCA : No