missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 5-Nitrobenzofuran-2-carboxylate 97.0+%, TCI America™
Supplier: TCI America E09505G
Specifications
| Ethyl 5-Nitrobenzofuran-2-carboxylate | |
| 153°C | |
| MFCD00275272 | |
| ethyl 5-nitrobenzofuran-2-carboxylate, ethyl 5-nitrobenzo b furan-2-carboxylate, 2-benzofurancarboxylic acid, 5-nitro-, ethyl ester, 5-nitrobenzofuran-2-carboxylic acid ethyl ester, ethyl 5-nitrobenzo d furan-2-carboxylate, 5-nitrobenzo b furan-2-carboxylic acid ethyl ester, pubchem15412, 5-nitro-2-benzofurancarboxylic acid ethyl ester, ethylnitrobenzofurancarboxylate, ksc352c3t | |
| CCOC(=O)C1=CC2=C(O1)C=CC(=C2)[N+](=O)[O-] | |
| 235.195 | |
| 235.20 | |
| Crystalline Powder |
| 69604-00-8 | |
| C11H9NO5 | |
| 5 g | |
| ATHBGWVHAWGMAL-UHFFFAOYSA-N | |
| ethyl 5-nitro-1-benzofuran-2-carboxylate | |
| 1382954 | |
| ≥97.0% (GC) |
Chemical Identifiers
| 69604-00-8 | |
| 235.195 | |
| ATHBGWVHAWGMAL-UHFFFAOYSA-N | |
| 1382954 | |
| CCOC(=O)C1=CC2=C(O1)C=CC(=C2)[N+](=O)[O-] |
| C11H9NO5 | |
| MFCD00275272 | |
| ethyl 5-nitrobenzofuran-2-carboxylate, ethyl 5-nitrobenzo b furan-2-carboxylate, 2-benzofurancarboxylic acid, 5-nitro-, ethyl ester, 5-nitrobenzofuran-2-carboxylic acid ethyl ester, ethyl 5-nitrobenzo d furan-2-carboxylate, 5-nitrobenzo b furan-2-carboxylic acid ethyl ester, pubchem15412, 5-nitro-2-benzofurancarboxylic acid ethyl ester, ethylnitrobenzofurancarboxylate, ksc352c3t | |
| ethyl 5-nitro-1-benzofuran-2-carboxylate |
Safety and Handling
TSCA : No