missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Alfa Aesar™ Ethyl 3-nitrobenzoate, 98+%
$81.58 - $283.76
Chemical Identifiers
| CAS | 618-98-4 |
|---|---|
| Molecular Formula | C9H9NO4 |
| Molecular Weight (g/mol) | 195.174 |
| MDL Number | MFCD00014702 |
| InChI Key | MKBIJCPQTPFQKQ-UHFFFAOYSA-N |
| Synonym | ethyl m-nitrobenzoate, benzoic acid, 3-nitro-, ethyl ester, ethyl-m-nitrobenzoate, m-nitrobenzoic acid, ethyl ester, benzoic acid, m-nitro-, ethyl ester, acmc-20akzc, 3-nitrobenzoic acid ethyl, benzoic acid, 3-nitro-,ethyl ester, benzoic acid, m-nitro-, ethyl ester 8ci, r---2-2-diphenylphosphino phenyl-4-phenyl-2-oxazoline |
| PubChem CID | 69261 |
| IUPAC Name | ethyl 3-nitrobenzoate |
| SMILES | CCOC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
| AAA1062614 |
Alfa Aesar™
A1062614 |
25g |
Each for $81.58
|
|
AAA1062622 |
Alfa Aesar™
A1062622 |
100g |
Each for $283.76
|
|
Chemical Identifiers
| 618-98-4 | |
| 195.174 | |
| MKBIJCPQTPFQKQ-UHFFFAOYSA-N | |
| 69261 | |
| CCOC(=O)C1=CC(=CC=C1)[N+](=O)[O-] |
| C9H9NO4 | |
| MFCD00014702 | |
| ethyl m-nitrobenzoate, benzoic acid, 3-nitro-, ethyl ester, ethyl-m-nitrobenzoate, m-nitrobenzoic acid, ethyl ester, benzoic acid, m-nitro-, ethyl ester, acmc-20akzc, 3-nitrobenzoic acid ethyl, benzoic acid, 3-nitro-,ethyl ester, benzoic acid, m-nitro-, ethyl ester 8ci, r---2-2-diphenylphosphino phenyl-4-phenyl-2-oxazoline | |
| ethyl 3-nitrobenzoate |
Specifications
| 297°C to 298°C | |
| 25g | |
| C9H9NO4 | |
| 1912880 | |
| ethyl m-nitrobenzoate, benzoic acid, 3-nitro-, ethyl ester, ethyl-m-nitrobenzoate, m-nitrobenzoic acid, ethyl ester, benzoic acid, m-nitro-, ethyl ester, acmc-20akzc, 3-nitrobenzoic acid ethyl, benzoic acid, 3-nitro-,ethyl ester, benzoic acid, m-nitro-, ethyl ester 8ci, r---2-2-diphenylphosphino phenyl-4-phenyl-2-oxazoline | |
| CCOC(=O)C1=CC(=CC=C1)[N+](=O)[O-] | |
| 195.174 | |
| 195.18 | |
| Ethyl 3-nitrobenzoate |
| 40°C to 43°C | |
| 618-98-4 | |
| MFCD00014702 | |
| 14,3832 | |
| MKBIJCPQTPFQKQ-UHFFFAOYSA-N | |
| ethyl 3-nitrobenzoate | |
| 69261 | |
| ≥98% |
Safety and Handling
TSCA : TSCA