missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ergosterol, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC117810250
Specifications
| Ergosterol | |
| Glass bottle | |
| -120 | |
| White | |
| 25g | |
| 97.5% min. (HPLC) | |
| MFCD00003623 | |
| 15, 3716 | |
| Solubility in water: practically insoluble in water. Other solubilities: soluble in benzene,1g/660 mL alcohol- 1g/45 mL boiling alcohol,1g/70 mL ether- 1g/39 mL boiling ether,1g/31 mL chloroform | |
| CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C | |
| 396.64 | |
| CHEBI:16933 | |
| Crystalline Powder or Crystalline Needles |
| Authentic | |
| −120.00 (20.00°C c=1,CHC13) | |
| 250°C (1.3 Pa) | |
| 156°C to 158°C | |
| 57-87-4 | |
| C28H44O | |
| 06,III,3099 | |
| 22e,24s-24-methylcholesta-5,7,22-trien-3beta-ol, 22e-ergosta-5,7,22-trien-3beta-ol, 3beta-hydroxy-5,7,22-ergostatriene, 5,7,22-ergostatrien-3beta-ol, ergosta-5,7,22-trien-3-ol, 3b,22e, ergosta-5,7,22e-trien-3beta-ol, ergosterin, ergosterol, provitamin d2, unii-z30ray509f | |
| DNVPQKQSNYMLRS-APGDWVJJSA-N | |
| (3S,9S,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol | |
| 444679 | |
| 396.64 | |
| 98% |
Chemical Identifiers
| 57-87-4 | |
| 396.64 | |
| DNVPQKQSNYMLRS-APGDWVJJSA-N | |
| 444679 | |
| (3S,9S,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| C28H44O | |
| MFCD00003623 | |
| 22e,24s-24-methylcholesta-5,7,22-trien-3beta-ol, 22e-ergosta-5,7,22-trien-3beta-ol, 3beta-hydroxy-5,7,22-ergostatriene, 5,7,22-ergostatrien-3beta-ol, ergosta-5,7,22-trien-3-ol, 3b,22e, ergosta-5,7,22e-trien-3beta-ol, ergosterin, ergosterol, provitamin d2, unii-z30ray509f | |
| CHEBI:16933 | |
| CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
Safety and Handling
EINECSNumber : 200-352-7