missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenylmethane, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 117350010
Specifications
| Diphenylmethane | |
| 127°C | |
| Glass bottle | |
| 1 | |
| Colorless to Yellow | |
| 1kg | |
| 101-81-5 | |
| C13H12 | |
| MFCD00004781 | |
| 15, 3362 | |
| Solubility in water: practically insoluble. Other solubilities: insoluble in liquid ammonia, freely soluble in alcohol, ether, chloroform,, hexane and benzene | |
| C1=CC=C(C=C1)CC2=CC=CC=C2 | |
| 168.24 | |
| CHEBI:38884 | |
| Low Melting Solid |
| 1.0000g/mL | |
| Authentic | |
| 1.5760 to 1.5780 | |
| 265.0°C | |
| 24.5°C to 25.0°C | |
| 99% | |
| 98.5% min. (GC) | |
| (C6H5)2CH2 | |
| 05, II, 498 | |
| 1,1'-dimethylenebis benzene, benzene, 1,1'-methylenebis, benzene, benzyl, benzene, phenylmethyl, diphenyl methane, diphenylmethane, ditan, ditane, methane, diphenyl, methylenedibenzene | |
| CZZYITDELCSZES-UHFFFAOYSA-N | |
| benzylbenzene | |
| 7580 | |
| 168.24 | |
| 99% |
Chemical Identifiers
| 101-81-5 | |
| 168.24 | |
| CZZYITDELCSZES-UHFFFAOYSA-N | |
| 7580 | |
| benzylbenzene |
| C13H12 | |
| MFCD00004781 | |
| 1,1'-dimethylenebis benzene, benzene, 1,1'-methylenebis, benzene, benzyl, benzene, phenylmethyl, diphenyl methane, diphenylmethane, ditan, ditane, methane, diphenyl, methylenedibenzene | |
| CHEBI:38884 | |
| C1=CC=C(C=C1)CC2=CC=CC=C2 |
Safety and Handling
GHS Signal Word: Warning
EINECSNumber : 202-978-6
RTECSNumber : DA4976500
TSCA : TSCA