missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenyliodonium chloride, 97%, ACROS Organics™
$240.96 - $240.96
Chemical Identifiers
| CAS | 1483-72-3 |
|---|---|
| Molecular Formula | C12H10I·Cl |
| Molecular Weight (g/mol) | 316.57 |
| MDL Number | MFCD00011909 |
| InChI Key | RSJLWBUYLGJOBD-UHFFFAOYSA-M |
| Synonym | acmc-1bxx9, c12h10i.cl, diphenyliodanium chloride, diphenyliodonium chloride, diphenyliodoniumchloride, iodonium, diphenyl-, chloride, iodonium, diphenyl-, chloride 1:1 |
| PubChem CID | 73870 |
| IUPAC Name | diphenyliodanium;chloride |
| SMILES | C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117330100
|
Thermo Fisher Scientific
117330100 |
10g | Glass bottle |
Each for $240.96
|
|
AC117330500
|
Thermo Fisher Scientific
AC117330500 |
50g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 1483-72-3 | |
| 316.57 | |
| RSJLWBUYLGJOBD-UHFFFAOYSA-M | |
| 73870 | |
| C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-] |
| C12H10I·Cl | |
| MFCD00011909 | |
| acmc-1bxx9, c12h10i.cl, diphenyliodanium chloride, diphenyliodonium chloride, diphenyliodoniumchloride, iodonium, diphenyl-, chloride, iodonium, diphenyl-, chloride 1:1 | |
| diphenyliodanium;chloride |
Specifications
| Authentic | |
| Cream-Yellow to White | |
| 10g | |
| 97% | |
| (C6H5)2ICl | |
| 01,341; 02,178 | |
| Solubility in water: soluble. Other solubilities: soluble in methanol | |
| C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[Cl-] | |
| 316.57 | |
| 316.57 | |
| 97% |
| Glass bottle | |
| 227°C to 228°C | |
| 1483-72-3 | |
| C12H10I·Cl | |
| MFCD00011909 | |
| acmc-1bxx9, c12h10i.cl, diphenyliodanium chloride, diphenyliodonium chloride, diphenyliodoniumchloride, iodonium, diphenyl-, chloride, iodonium, diphenyl-, chloride 1:1 | |
| RSJLWBUYLGJOBD-UHFFFAOYSA-M | |
| diphenyliodanium;chloride | |
| 73870 | |
| Powder | |
| Diphenyliodonium chloride |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
If skin irritation occurs: Get medical advice/attention.
If eye irritatio
GHS Signal Word: Danger
EINECSNumber : 216-049-8