Learn More
Diphenylacetic Acid, 99+%, ACROS Organics™
Manufacturer: Acros Organics 117151000
Specifications
| Diphenylacetic acid | |
| (10% soln. in 1M NaOH) clear, almost colorless, (5% soln. in ethanol) clear, almost colorless | |
| 200ppm max. | |
| Authentic | |
| 10ppm max. | |
| Plastic bottle | |
| 99+% | |
| (C6H5)2CHCO2H | |
| Solubility in water: soluble in hot water. Other solubilities: soluble in alcohol, ether and chloroform | |
| 15, 3346 | |
| 0.1% max. | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O | |
| 2,2-diphenylacetic acid | |
| 212.248 | |
| 100g | |
| 212.25 |
| 99+% | |
| 117-34-0 | |
| 20ppm max. | |
| benzilic acid: < 0.25% | |
| 0.5% max. | |
| ≥99% | |
| C14H12O2 | |
| MFCD00004251 | |
| 09, 673 | |
| 200ppm max. | |
| PYHXGXCGESYPCW-UHFFFAOYSA-N | |
| 146.0°C to 149.0°C | |
| Cream-White to White | |
| 8333 | |
| CHEBI:41967 | |
| Crystalline Powder |
Chemical Identifiers
| 117-34-0 | |
| 212.248 | |
| PYHXGXCGESYPCW-UHFFFAOYSA-N | |
| CHEBI:41967 | |
| C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)O |
| C14H12O2 | |
| MFCD00004251 | |
| 8333 | |
| 2,2-diphenylacetic acid |
Safety and Handling
GHS H Statement:
Causes skin irritation.
Causes serious eye irritation.
GHS P Statement:
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
EINECSNumber : 204-185-0
RTECSNumber : AH2515000
TSCA : TSCA