missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenyl carbonate, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC117230100
Specifications
| Diphenyl carbonate | |
| Authentic | |
| 301.0°C to 302.0°C | |
| 78.0°C to 81.0°C | |
| 102-09-0 | |
| C13H10O3 | |
| 06,158 | |
| carbonic acid diphenyl ester | |
| ROORDVPLFPIABK-UHFFFAOYSA-N | |
| diphenyl carbonate | |
| 7597 | |
| 214.22 | |
| 99% |
| 168°C | |
| Plastic drum | |
| White | |
| 10kg | |
| 99% | |
| (C6H5O)2CO | |
| 15,3354 | |
| Solubility in water: insoluble. Other solubilities: solulbe in acetone, hot alcohol, benzene, carbon, tetrachloride, ether, glacial acetic acid and, other organic solvents | |
| C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 | |
| 214.22 | |
| CHEBI:34722 | |
| Flakes or Crystalline Powder |
Chemical Identifiers
| 102-09-0 | |
| 214.22 | |
| carbonic acid diphenyl ester | |
| CHEBI:34722 | |
| C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| C13H10O3 | |
| ROORDVPLFPIABK-UHFFFAOYSA-N | |
| 7597 | |
| diphenyl carbonate |
Safety and Handling
GHS H Statement:
Harmful if swallowed.
GHS P Statement:
Wear protective gloves/protective clothing.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.