missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diphenyl carbonate, 99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC117230100
Specifications
| Diphenyl carbonate | |
| Authentic | |
| 301.0°C to 302.0°C | |
| 78.0°C to 81.0°C | |
| 102-09-0 | |
| C13H10O3 | |
| 06,158 | |
| carbonic acid diphenyl ester, carbonic acid, diphenyl ester, diphenylcarbonate, ph2co3, phenyl carbonate, phenyl carbonate pho 2co, phenyl phenoxyformate, pho 2co, unii-ywv401idyn, ywv401idyn | |
| ROORDVPLFPIABK-UHFFFAOYSA-N | |
| diphenyl carbonate | |
| 7597 | |
| 214.22 | |
| 99% |
| 168°C | |
| Plastic drum | |
| White | |
| 10kg | |
| 98.5% min. (GC) | |
| (C6H5O)2CO | |
| 15,3354 | |
| Solubility in water: insoluble. Other solubilities: solulbe in acetone, hot alcohol, benzene, carbon, tetrachloride, ether, glacial acetic acid and, other organic solvents | |
| C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 | |
| 214.22 | |
| CHEBI:34722 | |
| Flakes or Crystalline Powder |
Chemical Identifiers
| 102-09-0 | |
| 214.22 | |
| carbonic acid diphenyl ester, carbonic acid, diphenyl ester, diphenylcarbonate, ph2co3, phenyl carbonate, phenyl carbonate pho 2co, phenyl phenoxyformate, pho 2co, unii-ywv401idyn, ywv401idyn | |
| CHEBI:34722 | |
| C1=CC=C(C=C1)OC(=O)OC2=CC=CC=C2 |
| C13H10O3 | |
| ROORDVPLFPIABK-UHFFFAOYSA-N | |
| 7597 | |
| diphenyl carbonate |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Toxic to aquatic life with long lasting effects.
GHS P Statement
Wear protective gloves/protective clothing.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
GHS Signal Word: Warning
EINECSNumber : 203-005-8