missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dioctyl sulfosuccinate, sodium salt, 96%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC117100025
Specifications
| 2.5 max. (on solids basis) | |
| Authentic | |
| Plastic drum | |
| White | |
| 2.5kg | |
| 95% min | |
| MFCD00012455 | |
| 15,149 | |
| aerosol ot, clestol, complemix, constonate, defilin, dioctyl sodium sulfosuccinate, diomedicone, diox, docusate sodium, manoxol ot | |
| APSBXTVYXVQYAB-UHFFFAOYNA-M | |
| sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate | |
| 23673837 | |
| Waxy Solid |
| Dioctyl sulfosuccinate, sodium salt | |
| 300ppm (50% max. in toluene) | |
| 2% max. | |
| 153.0°C to 157.0°C | |
| 577-11-7 | |
| C20H37NaO7S | |
| 04, IV, 114 | |
| 15, 3446 | |
| Solubility in water: 1.5g/100mL (25°C). Other solubilities: soluble in ccl4,petroleum ether,xylene and,alcohol | |
| [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O | |
| 444.56 | |
| 444.55 | |
| 96% |
Chemical Identifiers
| 577-11-7 | |
| 444.56 | |
| APSBXTVYXVQYAB-UHFFFAOYNA-M | |
| 23673837 | |
| [Na+].CCCCC(CC)COC(=O)CC(C(=O)OCC(CC)CCCC)S([O-])(=O)=O |
| C20H37NaO7S | |
| MFCD00012455 | |
| aerosol ot, clestol, complemix, constonate, defilin, dioctyl sodium sulfosuccinate, diomedicone, diox, docusate sodium, manoxol ot | |
| sodium;1,4-bis(2-ethylhexoxy)-1,4-dioxobutane-2-sulfonate |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye damage.
GHS P Statement
Avoid breathing dust/fume/gas/mist/vapors/spray.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/e
GHS Signal Word: Danger
EINECSNumber : 209-406-4