missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
(-)-Diisopropyl D-tartrate, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 211180500
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| (-)-Diisopropyl D-tartrate | |
| 62961-64-2 | |
| 100.0 | |
| 275°C | |
| Authentic | |
| Glass bottle | |
| 1.4380 to 1.44 | |
| MFCD00008876 | |
| 13,276 | |
| −17.25° (20°C neat) | |
| diisopropyl d-tartrate, 2s,3s-diisopropyl 2,3-dihydroxysuccinate, --diisopropyl d-tartrate, -diisopropyl-d-tartrate, d---tartaric acid diisopropyl ester, diisopropyl d---tartrate, butanedioic acid, 2,3-dihydroxy-, bis 1-methylethyl ester, 2s,3s, d---diisopropyl tartrate, d-dipt, --d-tartaric acid diisopropyl ester, diisoprropyl-d-tartrate | |
| CC(C)OC(=O)C(C(C(=O)OC(C)C)O)O | |
| 234.25 | |
| 234.25 |
| 99% | |
| 98.5 | |
| 1.1100g/mL | |
| 110°C | |
| 98.5% min. (GC) | |
| C10H18O6 | |
| [-CH(OH)CO2CH(CH3)2]2 | |
| 50g | |
| 1.11 | |
| -17.25 | |
| XEBCWEDRGPSHQH-YUMQZZPRSA-N | |
| dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate | |
| 112972 | |
| 99% |
Chemical Identifiers
| 62961-64-2 | |
| 234.25 | |
| XEBCWEDRGPSHQH-YUMQZZPRSA-N | |
| 112972 | |
| CC(C)OC(=O)C(C(C(=O)OC(C)C)O)O |
| C10H18O6 | |
| MFCD00008876 | |
| diisopropyl d-tartrate, 2s,3s-diisopropyl 2,3-dihydroxysuccinate, --diisopropyl d-tartrate, -diisopropyl-d-tartrate, d---tartaric acid diisopropyl ester, diisopropyl d---tartrate, butanedioic acid, 2,3-dihydroxy-, bis 1-methylethyl ester, 2s,3s, d---diisopropyl tartrate, d-dipt, --d-tartaric acid diisopropyl ester, diisoprropyl-d-tartrate | |
| dipropan-2-yl (2S,3S)-2,3-dihydroxybutanedioate |
Safety and Handling
HYGROSCOPIC
EINECSNumber : 263-771-4
TSCA : TSCA
RUO â Research Use Only