missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Diethyl 4-aminobenzylphosphonate, 98%, ACROS Organics™
Manufacturer: Fisher Scientific Acros 114010050
Description
for C-C Bond Formation (Olefination)Specifications
| Diethyl 4-aminobenzylphosphonate | |
| Glass bottle | |
| 90°C to 94°C | |
| 98% | |
| 98% | |
| (C2H5O)2P(O)CH2C6H4NH2 | |
| 4-diethoxyphosphorylmethyl aniline, diethyl 4-aminobenzylphosphonate, diethyl 4-aminophenyl methylphosphonate, diethyl p-aminobenzyl phosphonate, diethyl p-aminobenzylphosphonate, p-aminobenzylphosphonic acid diethyl ester, phosphonic acid, 4-aminophenyl methyl-, diethyl ester, phosphonic acid, p-aminobenzyl-, diethyl ester, timtec-bb sbb000830 | |
| CCOP(=O)(CC1=CC=C(C=C1)N)OCC | |
| 243.24 | |
| 243.24 | |
| 98% |
| Authentic | |
| Beige to Brown | |
| 5g | |
| 20074-79-7 | |
| C11H18NO3P | |
| MFCD00007913 | |
| ZVAYUUUQOCPZCZ-UHFFFAOYSA-N | |
| 4-(diethoxyphosphorylmethyl)aniline | |
| 88358 | |
| Crystals or Crystalline Powder |
Chemical Identifiers
| 20074-79-7 | |
| 243.24 | |
| ZVAYUUUQOCPZCZ-UHFFFAOYSA-N | |
| 88358 | |
| CCOP(=O)(CC1=CC=C(C=C1)N)OCC |
| C11H18NO3P | |
| MFCD00007913 | |
| 4-diethoxyphosphorylmethyl aniline, diethyl 4-aminobenzylphosphonate, diethyl 4-aminophenyl methylphosphonate, diethyl p-aminobenzyl phosphonate, diethyl p-aminobenzylphosphonate, p-aminobenzylphosphonic acid diethyl ester, phosphonic acid, 4-aminophenyl methyl-, diethyl ester, phosphonic acid, p-aminobenzyl-, diethyl ester, timtec-bb sbb000830 | |
| 4-(diethoxyphosphorylmethyl)aniline |
Safety and Handling
EINECSNumber : 243-504-8
RTECSNumber : SZ6480000