missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dicyclohexyl phthalate, 99%, ACROS Organics™
$24.30 - $24.30
Chemical Identifiers
| CAS | 84-61-7 |
|---|---|
| Molecular Formula | C20H26O4 |
| Molecular Weight (g/mol) | 330.424 |
| MDL Number | MFCD00003849 |
| InChI Key | VOWAEIGWURALJQ-UHFFFAOYSA-N |
| Synonym | dicyclohexyl phthalate, ergoplast fdc, unimoll 66, ergoplast.fdc, howflex cp, phthalic acid, dicyclohexyl ester, phthalic acid dicyclohexyl ester, 1,2-benzenedicarboxylic acid, dicyclohexyl ester, unii-cgd15m7h2n, ccris 6190 |
| PubChem CID | 6777 |
| ChEBI | CHEBI:34693 |
| IUPAC Name | dicyclohexyl benzene-1,2-dicarboxylate |
| SMILES | C1CCC(CC1)OC(=O)C2=CC=CC=C2C(=O)OC3CCCCC3 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC375050025 SDS |
Acros Organics
AC375050025 |
2.5kg | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC375050050 SDS |
Acros Organics
AC375050050 |
5g | Glass bottle |
Each for $24.30
|
|
AC375052500 SDS |
Acros Organics
AC375052500 |
250g | Glass bottle | N/A | N/A |
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
| AC375050010 SDS |
Acros Organics
AC375050010 |
1kg | Glass bottle | N/A | N/A | ||||
| Please call Customer Service at 1-800-234-7437 or send an email to help@thermofisher.com for assistance. | |||||||||
Chemical Identifiers
| 84-61-7 | |
| 330.424 | |
| VOWAEIGWURALJQ-UHFFFAOYSA-N | |
| 6777 | |
| dicyclohexyl benzene-1,2-dicarboxylate |
| C20H26O4 | |
| MFCD00003849 | |
| dicyclohexyl phthalate, ergoplast fdc, unimoll 66, ergoplast.fdc, howflex cp, phthalic acid, dicyclohexyl ester, phthalic acid dicyclohexyl ester, 1,2-benzenedicarboxylic acid, dicyclohexyl ester, unii-cgd15m7h2n, ccris 6190 | |
| CHEBI:34693 | |
| C1CCC(CC1)OC(=O)C2=CC=CC=C2C(=O)OC3CCCCC3 |
Specifications
| 207g/mL | |
| Authentic | |
| 200.0°C to 235.0°C (4.0mmHg) | |
| 63.0°C | |
| 84-61-7 | |
| C20H26O4 | |
| dicyclohexyl phthalate, ergoplast fdc, unimoll 66, ergoplast.fdc, howflex cp, phthalic acid, dicyclohexyl ester, phthalic acid dicyclohexyl ester, 1,2-benzenedicarboxylic acid, dicyclohexyl ester, unii-cgd15m7h2n, ccris 6190 | |
| C1CCC(CC1)OC(=O)C2=CC=CC=C2C(=O)OC3CCCCC3 | |
| 330.424 | |
| CHEBI:34693 | |
| Crystalline Powder | |
| Dicyclohexyl phthalate |
| 207°C | |
| Glass bottle | |
| White | |
| 2.5kg | |
| 99% | |
| MFCD00003849 | |
| VOWAEIGWURALJQ-UHFFFAOYSA-N | |
| dicyclohexyl benzene-1,2-dicarboxylate | |
| 6777 | |
| 330.42 | |
| 99% |