missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Dichlorodiphenylsilane, 97%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC113340025
Specifications
| Dichlorodiphenylsilane | |
| 155°C | |
| Glass bottle | |
| 1.204 | |
| Brown or Colorless to Yellow | |
| 2.5L | |
| 96% min. (GC) | |
| (C6H5)2SiCl2 | |
| 13,74 | |
| Solubility in water: decomposes | |
| C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(Cl)Cl | |
| 253.2 | |
| 253.2 | |
| 97% |
| 1.2040g/mL | |
| Authentic | |
| 1.5765 to 1.5815 | |
| 305.0°C | |
| -22.0°C | |
| 80-10-4 | |
| C12H10Cl2Si | |
| 16,91 | |
| benzene, 1,1'-dichlorosilylene bis | |
| OSXYHAQZDCICNX-UHFFFAOYSA-N | |
| dichloro(diphenyl)silane | |
| 6627 | |
| Liquid |
Chemical Identifiers
| 80-10-4 | |
| 253.2 | |
| benzene, 1,1'-dichlorosilylene bis | |
| dichloro(diphenyl)silane |
| C12H10Cl2Si | |
| OSXYHAQZDCICNX-UHFFFAOYSA-N | |
| 6627 | |
| C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(Cl)Cl |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
May cause respiratory irritation.
Harmful to aquatic life with long lasting effects.
Reacts violently with water.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Gently wash with plenty of soap and water.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF IN EYES: Rinse cautiously wit
GHS Signal Word: Danger
EINECSNumber : 201-251-