Learn More
Dichlorodiphenylsilane, 97%, ACROS Organics™
Manufacturer: Acros Organics AC113340025
Specifications
| Dichlorodiphenylsilane | |
| 155°C | |
| 305.0°C | |
| -22.0°C | |
| 80-10-4 | |
| Glass bottle | |
| 97% | |
| C12H10Cl2Si | |
| Diphenyldichlorosilane | |
| C1=CC=C(C=C1)[Si](C2=CC=CC=C2)(Cl)Cl | |
| 253.197 | |
| 253.2 |
| 1.2040g/mL | |
| 1.204 | |
| Brown or Colorless to Yellow | |
| 2.5L | |
| Authentic | |
| 1.5765 to 1.5815 | |
| 97% | |
| (C6H5)2SiCl2 | |
| OSXYHAQZDCICNX-UHFFFAOYSA-N | |
| dichloro(diphenyl)silane | |
| 6627 | |
| Liquid |
Chemical Identifiers
| 80-10-4 | |
| 253.197 | |
| Diphenyldichlorosilane |
| C12H10Cl2Si | |
| OSXYHAQZDCICNX-UHFFFAOYSA-N | |
| 6627 |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage. May cause respiratory irritation. Harmful to aquatic life with long lasting effects. Reacts violently with water.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection. IF ON SKIN: Gently wash with plenty of soap and water. IF SWALLOWED: rinse mouth. Do NOT induce vomiting. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing. Store in a dry place. Store in a closed container. IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell. IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing.
Danger