Learn More
Dibenzothiophene, 98%, Thermo Scientific™
Manufacturer: Thermo Fisher Scientific 112541000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Dibenzothiophene | |
| Gray-Green to White | |
| 332°C to 333°C | |
| 97.5% min. (GC) | |
| C12H8S | |
| 17,72 | |
| .alpha.-thiafluorene, 1,1'-biphenyl-2,2'-diyl sulfide, 2,2'-biphenylylene sulfide, 9-thiafluorene, alpha-thiafluorene, dibenzo b,d thiophene, diphenylene sulfide, unii-z3d4aj1r48, usan | |
| Solubility in water: soluble. Other solubilities: soluble in ethanol,benzene,chloroform | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 | |
| 184.26 | |
| CHEBI:23681 | |
| Crystalline Powder and/or Chunks |
| 132-65-0 | |
| 97°C to 100°C | |
| 170°C | |
| Authentic | |
| MFCD00004969 | |
| Plastic bottle | |
| 100g | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| dibenzothiophene | |
| 3023 | |
| 184.26 | |
| 98% |
Chemical Identifiers
| 132-65-0 | |
| 184.26 | |
| IYYZUPMFVPLQIF-UHFFFAOYSA-N | |
| 3023 | |
| dibenzothiophene |
| C12H8S | |
| MFCD00004969 | |
| .alpha.-thiafluorene, 1,1'-biphenyl-2,2'-diyl sulfide, 2,2'-biphenylylene sulfide, 9-thiafluorene, alpha-thiafluorene, dibenzo b,d thiophene, diphenylene sulfide, unii-z3d4aj1r48, usan | |
| CHEBI:23681 | |
| C1=CC=C2C(=C1)C3=CC=CC=C3S2 |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Very toxic to aquatic life with long lasting effects.
GHS P Statement
Wash face,hands and any exposed skin thoroughly after handling.
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
Avoid release to the environment.
Collect spillage.
Dispose of contents/
GHS Signal Word: Warning
EINECSNumber : 205-072-9
RUO – Research Use Only