missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific Chemicals D-Phenylalanine, 99+%
$170.75 - $481.49
Chemical Identifiers
| CAS | 673-06-3 |
|---|---|
| Molecular Formula | C9H11NO2 |
| Molecular Weight (g/mol) | 165.19 |
| MDL Number | MFCD00004270 |
| InChI Key | COLNVLDHVKWLRT-MRVPVSSYSA-N |
| Synonym | d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid |
| PubChem CID | 71567 |
| ChEBI | CHEBI:16998 |
| IUPAC Name | (2R)-2-amino-3-phenylpropanoic acid |
| SMILES | N[C@H](CC1=CC=CC=C1)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC172040250
|
Thermo Scientific Chemicals
172040250 |
25 g | Glass Bottle |
Each for $170.75
|
|
||||
|
AC172041000
|
Thermo Scientific Chemicals
172041000 |
100 g | Glass Bottle |
Each for $481.49
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 673-06-3 | |
| 165.19 | |
| COLNVLDHVKWLRT-MRVPVSSYSA-N | |
| 71567 | |
| (2R)-2-amino-3-phenylpropanoic acid |
| C9H11NO2 | |
| MFCD00004270 | |
| d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid | |
| CHEBI:16998 | |
| N[C@H](CC1=CC=CC=C1)C(O)=O |
Specifications
| 673-06-3 | |
| White | |
| 99+% | |
| Authentic | |
| MFCD00004270 | |
| 0.5% max. | |
| Glass Bottle | |
| COLNVLDHVKWLRT-MRVPVSSYSA-N | |
| (2R)-2-amino-3-phenylpropanoic acid | |
| 165.19 | |
| CHEBI:16998 | |
| ≥99.0% | |
| +33.50° (20°C c=2,H2O) | |
| Powder |
| 3ppm max. | |
| 20ppm max. | |
| C9H11NO2 | |
| C6H5CH2CH(NH2)CO2H | |
| 14, 494 | |
| 15, 7382 | |
| d-phenylalanine, h-d-phe-oh, 2r-2-amino-3-phenylpropanoic acid, d-phe, sabiden, phenylalanine d-form, alanine, phenyl-, d, d-diphenylalanine, r-2-amino-3-phenylpropanoic acid, d-alpha-amino-beta-phenylpropionic acid | |
| N[C@H](CC1=CC=CC=C1)C(O)=O | |
| +32° to +35° (20°C, 589nm) (c=2, water) | |
| 71567 | |
| 165.19 | |
| 0.1% max. | |
| 25 g | |
| D-Phenylalanine |
RUO – Research Use Only