missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
D(+)-Glucurono-3,6-lactone, 99+%, Acros Organics™
Manufacturer: Fisher Scientific Acros 225921000
Specifications
| (10% aq. soln.) clear, colorless | |
| Passes Tests | |
| 0.5% max. (80°C) | |
| +19.00 (20.00°C c=10,H2O) | |
| 0.1% max. | |
| 170.0°C to 176.0°C | |
| 99+% | |
| 99+% | |
| MFCD00135622 | |
| d-glucuro-3,6-lactone | |
| UYUXSRADSPPKRZ-KKQCNMDGSA-N | |
| (2S)-2-[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde | |
| 91634076 | |
| Crystals or Crystalline Powder |
| D(+)-Glucurono-3, 6-lactone | |
| Authentic | |
| Plastic bottle | |
| + 19.00 | |
| White | |
| 100g | |
| 32449-92-6 | |
| C6H8O6 | |
| 15, 4503 | |
| Solubility in water: soluble in water. Other solubilities: slightly soluble in glacial acetic acid, slightly soluble in methanol and absolute, ethanol | |
| C(=O)C(C1C(C(C(=O)O1)O)O)O | |
| 176.12 | |
| 176.12 | |
| ≥99% |
Chemical Identifiers
| 32449-92-6 | |
| 176.12 | |
| UYUXSRADSPPKRZ-KKQCNMDGSA-N | |
| 91634076 | |
| C(=O)C(C1C(C(C(=O)O1)O)O)O |
| C6H8O6 | |
| MFCD00135622 | |
| d-glucuro-3,6-lactone | |
| (2S)-2-[(2S,3S,4R)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde |
Safety and Handling
EINECSNumber : 251-053-3
RTECSNumber : LZ8930000
TSCA : TSCA