missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
D(+)-Camphor, 97%, ACROS Organics™
$62.88 - $260.32
Chemical Identifiers
| CAS | 464-49-3 |
|---|---|
| Molecular Formula | C10H16O |
| Molecular Weight (g/mol) | 152.24 |
| MDL Number | MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 |
| InChI Key | DSSYKIVIOFKYAU-XVKPBYJWSA-N |
| Synonym | +-2-bornanone, +-bornan-2-one, +-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, 1r-+-camphor, camphor d, d-camphor, r-+-camphor, r-camphor |
| PubChem CID | 159055 |
| ChEBI | CHEBI:15396 |
| IUPAC Name | (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC227841000
|
Thermo Fisher Scientific
227841000 |
100g | Plastic bottle |
Each for $62.88
|
|
AC227845000
|
Thermo Fisher Scientific
227845000 |
500g | Plastic bottle |
Each for $260.32
|
|
Chemical Identifiers
| 464-49-3 | |
| 152.24 | |
| DSSYKIVIOFKYAU-XVKPBYJWSA-N | |
| 159055 | |
| (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
| C10H16O | |
| MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 | |
| +-2-bornanone, +-bornan-2-one, +-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, 1r-+-camphor, camphor d, d-camphor, r-+-camphor, r-camphor | |
| CHEBI:15396 | |
| CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 |
Specifications
| 64°C | |
| Plastic bottle | |
| 204.0°C | |
| 176.0°C to 180.0°C | |
| 464-49-3 | |
| C10H16O | |
| 13,61 | |
| +-2-bornanone, +-bornan-2-one, +-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, 1r-+-camphor, camphor d, d-camphor, r-+-camphor, r-camphor | |
| DSSYKIVIOFKYAU-XVKPBYJWSA-N | |
| (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one | |
| 159055 | |
| 152.24 | |
| 97% |
| Authentic | |
| + 42.50 | |
| White | |
| 100g | |
| 96% min. (GC) | |
| MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 | |
| 15, 1734 | |
| Solubility in water: 1g/800mL water (25°C) (giving a colloidal solutio. Other solubilities: at 25°C 1 g dissolves in 1 mL alcohol,1 mL ether,,0.5 mL chloroform,0.4 mL benzene,0.4 mL acetone,,1.5 mL turpentine oil,0.5 mL glacial acetic acid | |
| CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 | |
| 152.24 | |
| CHEBI:15396 | |
| Crystals | |
| D(+)-Camphor, 97% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Flammable solid.
Harmful if swallowed.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cauti
GHS Signal Word: Warning
EINECSNumber : 207-355-2
RTECSNumber : EX1260000
TSCA : TSCA