Learn More
D(+)-Camphor, 97%, Thermo Scientific™
$60.48 - $256.35
Chemical Identifiers
| CAS | 464-49-3 |
|---|---|
| Molecular Formula | C10H16O |
| Molecular Weight (g/mol) | 152.24 |
| MDL Number | MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 |
| InChI Key | DSSYKIVIOFKYAU-XVKPBYJWSA-N |
| Synonym | +-2-bornanone, +-bornan-2-one, +-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, 1r-+-camphor, camphor d, d-camphor, r-+-camphor, r-camphor |
| PubChem CID | 159055 |
| ChEBI | CHEBI:15396 |
| IUPAC Name | (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC227841000
|
Thermo Fisher Scientific
227841000 |
100g | Plastic bottle |
Each for $60.48
|
|
AC227845000
|
Thermo Fisher Scientific
227845000 |
500g | Plastic bottle |
Each for $256.35
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 464-49-3 | |
| 152.24 | |
| DSSYKIVIOFKYAU-XVKPBYJWSA-N | |
| 159055 | |
| (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one |
| C10H16O | |
| MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 | |
| +-2-bornanone, +-bornan-2-one, +-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, 1r-+-camphor, camphor d, d-camphor, r-+-camphor, r-camphor | |
| CHEBI:15396 | |
| CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 |
Specifications
| 464-49-3 | |
| 176.0°C to 180.0°C | |
| 64°C | |
| C10H16O | |
| MFCD00064149,MFCD00074738,MFCD00064149,MFCD00064149 | |
| 13,61 | |
| 100g | |
| Solubility in water: 1g/800mL water (25°C) (giving a colloidal solutio. Other solubilities: at 25°C 1 g dissolves in 1 mL alcohol,1 mL ether,,0.5 mL chloroform,0.4 mL benzene,0.4 mL acetone,,1.5 mL turpentine oil,0.5 mL glacial acetic acid | |
| CC1(C)[C@H]2CC[C@@]1(C)C(=O)C2 | |
| (1R,4R)-4,7,7-trimethylbicyclo[2.2.1]heptan-3-one | |
| 159055 | |
| 152.24 | |
| 97% |
| White | |
| 204.0°C | |
| 96% min. (GC) | |
| Authentic | |
| Plastic bottle | |
| 15, 1734 | |
| +-2-bornanone, +-bornan-2-one, +-camphor, 1r,4r-1,7,7-trimethylbicyclo 2.2.1 heptan-2-one, 1r,4r-camphor, 1r-+-camphor, camphor d, d-camphor, r-+-camphor, r-camphor | |
| DSSYKIVIOFKYAU-XVKPBYJWSA-N | |
| + 42.50 | |
| 152.24 | |
| CHEBI:15396 | |
| Crystals | |
| D(+)-Camphor, 97% |
Safety and Handling
GHS H Statement
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
Flammable solid.
Harmful if swallowed.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
IF ON SKIN: Wash with plenty of soap and water.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cauti
GHS Signal Word: Warning
EINECSNumber : 207-355-2
RTECSNumber : EX1260000
TSCA : TSCA
RUO – Research Use Only