missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific™ D(-)-Arabinose, 99+%
$80.63 - $249.63
Chemical Identifiers
| CAS | 28697-53-2 |
|---|---|
| Molecular Formula | C5H10O5 |
| Molecular Weight (g/mol) | 150.13 |
| MDL Number | MFCD00064361,MFCD20731172,MFCD00006609,MFCD00066648,MFCD09864633 |
| InChI Key | PYMYPHUHKUWMLA-DEOSMSJNSA-N |
| Synonym | 2s,3s,4r,5r-oxane-2,3,4,5-tetrol, 2s,3s,4r,5r-tetrahydro-2h-pyran-2,3,4,5-tetraol, a-d-arabinopyranose, alpha-arabinose, alpha-d-arabinopyranose, alpha-d-arabinopyranose 9ci, d--arabinose |
| PubChem CID | 71313478 |
| IUPAC Name | (4S,5R)-oxane-2,3,4,5-tetrol |
| SMILES | OCC(O)[C@@H](O)[C@H](O)C=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC161450250
|
Thermo Scientific™
161450250 |
25g | Plastic bottle |
Each for $80.63
|
|
AC161451000
|
Thermo Scientific™
161451000 |
100g | Plastic bottle |
Each for $249.63
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 28697-53-2 | |
| 150.13 | |
| PYMYPHUHKUWMLA-DEOSMSJNSA-N | |
| 71313478 | |
| OCC(O)[C@@H](O)[C@H](O)C=O |
| C5H10O5 | |
| MFCD00064361,MFCD20731172,MFCD00006609,MFCD00066648,MFCD09864633 | |
| 2s,3s,4r,5r-oxane-2,3,4,5-tetrol, 2s,3s,4r,5r-tetrahydro-2h-pyran-2,3,4,5-tetraol, a-d-arabinopyranose, alpha-arabinose, alpha-d-arabinopyranose, alpha-d-arabinopyranose 9ci, d--arabinose | |
| (4S,5R)-oxane-2,3,4,5-tetrol |
Specifications
| 28697-53-2 | |
| 152.0°C to 160.0°C | |
| C5H10O5 | |
| MFCD00064361,MFCD20731172,MFCD00006609,MFCD00066648,MFCD09864633 | |
| 31, 34 | |
| 2s,3s,4r,5r-oxane-2,3,4,5-tetrol, 2s,3s,4r,5r-tetrahydro-2h-pyran-2,3,4,5-tetraol, a-d-arabinopyranose, alpha-arabinose, alpha-d-arabinopyranose, alpha-d-arabinopyranose 9ci, d--arabinose | |
| PYMYPHUHKUWMLA-DEOSMSJNSA-N | |
| − 103.50 | |
| 150.13 | |
| 150.13 | |
| 99+% | |
| 0.5% Max. (K.F.) |
| Undesignated | |
| 99% min. (ELSD) (HPLC) | |
| Authentic | |
| Plastic bottle | |
| 25g | |
| Solubility in water: soluble. Other solubilities: soluble in glycerol and ether | |
| OCC(O)[C@@H](O)[C@H](O)C=O | |
| (4S,5R)-oxane-2,3,4,5-tetrol | |
| 71313478 | |
| Liquid | |
| 0.1 % max. | |
| D(-)-Arabinose, p.a. |
RUO – Research Use Only