missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
D(+)-10-Camphorsulfonic acid, 99%, ACROS Organics™
$108.63 - $341.85
Chemical Identifiers
| CAS | 3144-16-9 |
|---|---|
| Molecular Formula | C10H15O4S |
| Molecular Weight (g/mol) | 231.29 |
| MDL Number | MFCD00064157,MFCD00074827 |
| InChI Key | MIOPJNTWMNEORI-XVKPBYJWSA-M |
| Synonym | 1s,4r-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, camphersulfosaeure german, camphor-10-sulfonic acid, d-+-10-camphorsulfonic acid, d-+-camphor-10-sulfonic acid, d-camphor-10-sulfonic acid, d-camphorsulfonic acid, dl-10-camphorsulfonic acid, r-camphorsulfonic acid, unii-9tlz01s15l |
| PubChem CID | 65617 |
| ChEBI | CHEBI:55403 |
| IUPAC Name | [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(C)[C@H]2CC[C@]1(CS([O-])(=O)=O)C(=O)C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC108221000
|
Thermo Fisher Scientific
108221000 |
100g | Plastic bottle |
Each for $108.63
|
|
AC108225000
|
Thermo Fisher Scientific
108225000 |
500g | Plastic bottle |
Each for $341.85
|
|
Chemical Identifiers
| 3144-16-9 | |
| 231.29 | |
| MIOPJNTWMNEORI-XVKPBYJWSA-M | |
| 65617 | |
| [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| C10H15O4S | |
| MFCD00064157,MFCD00074827 | |
| 1s,4r-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, camphersulfosaeure german, camphor-10-sulfonic acid, d-+-10-camphorsulfonic acid, d-+-camphor-10-sulfonic acid, d-camphor-10-sulfonic acid, d-camphorsulfonic acid, dl-10-camphorsulfonic acid, r-camphorsulfonic acid, unii-9tlz01s15l | |
| CHEBI:55403 | |
| CC1(C)[C@H]2CC[C@]1(CS([O-])(=O)=O)C(=O)C2 |
Specifications
| Authentic | |
| Plastic bottle | |
| 500ppm max | |
| >190.0°C | |
| 3144-16-9 | |
| C10H15O4S | |
| 11,IV,642 | |
| 15, 1736 | |
| Solubility in water: soluble. Other solubilities: slightly soluble in glacial acetic acid,slightly soluble in ethyl acetate,practically insoluble in ether,very soluble in ethanol | |
| CC1(C)[C@H]2CC[C@]1(CS([O-])(=O)=O)C(=O)C2 | |
| 231.29 | |
| CHEBI:55403 | |
| Crystalline Powder | |
| D(+)-10-Camphorsulfonic acid, 99% |
| 2% max. (1 g, 105°C, 5 hrs) | |
| + 22.00 | |
| White | |
| 100g | |
| 99% | |
| MFCD00064157,MFCD00074827 | |
| 01,108; 02,58; 04,68; 13,62; 14,71; 16,58 | |
| 1s,4r-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, camphersulfosaeure german, camphor-10-sulfonic acid, d-+-10-camphorsulfonic acid, d-+-camphor-10-sulfonic acid, d-camphor-10-sulfonic acid, d-camphorsulfonic acid, dl-10-camphorsulfonic acid, r-camphorsulfonic acid, unii-9tlz01s15l | |
| MIOPJNTWMNEORI-XVKPBYJWSA-M | |
| [(1R,4S)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid | |
| 65617 | |
| 232.3 | |
| 99% |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 221-554-1
RTECSNumber : ED1550000
TSCA : TSCA