Learn More
Cytosine β-D-arabinofuranoside hydrochloride, 99%, crystalline, ACROS Organics™
$1,299.97 - $1,299.97
Chemical Identifiers
| CAS | 69-74-9 |
|---|---|
| Molecular Formula | C9H13N3O5·HCl |
| Molecular Weight (g/mol) | 279.67 |
| MDL Number | MFCD00012839 |
| InChI Key | KCURWTAZOZXKSJ-JCEIVDPDSA-N |
| Synonym | cytarabine hydrochloride |
| PubChem CID | 134129637 |
| IUPAC Name | 4-amino-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride |
| SMILES | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O.Cl |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC227180050 SDS |
Thermo Fisher Scientific
AC227180050 |
5g | Glass bottle |
Each for $1,299.97
|
|
||||
Chemical Identifiers
| 69-74-9 | |
| 279.67 | |
| KCURWTAZOZXKSJ-JCEIVDPDSA-N | |
| 134129637 | |
| C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O.Cl |
| C9H13N3O5·HCl | |
| MFCD00012839 | |
| cytarabine hydrochloride | |
| 4-amino-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride |
Specifications
| Authentic | |
| +127° to +133° (20°C, 589nm) ((c=0.7, H2O)) | |
| 197.0°C to 198.0°C | |
| 69-74-9 | |
| C9H13N3O5·HCl | |
| 10, 2778 | |
| KCURWTAZOZXKSJ-JCEIVDPDSA-N | |
| 4-amino-1-[(2S,3R,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride | |
| 134129637 | |
| Crystalline Powder | |
| Cytosine β-D-arabinofuranoside hydrochloride |
| Glass bottle | |
| White | |
| 5g | |
| 98.5% min. (HPLC) | |
| MFCD00012839 | |
| cytarabine hydrochloride | |
| C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O.Cl | |
| 279.67 | |
| 279.67 | |
| 99% |
Safety and Handling
GHS H Statement:
May cause an allergic skin reaction.
Causes serious eye irritation.
Suspected of damaging the unborn child.
GHS P Statement:
Wear eye protection/face protection.
Use personal protective equipment as required.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses, if present and easy to do. Continue rinsing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Warning
EINECSNumber : 200-713-9