missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Cytarabine, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific AC449561000
Specifications
| Cytarabine | |
| 220.0°C | |
| 147-94-4 | |
| C9H13N3O5 | |
| ara-c, arabinocytidine, arabinosylcytosine, aracytidine, cytarabin, cytarabine, cytarabinoside, cytosar, cytosine arabinoside, tarabine | |
| UHDGCWIWMRVCDJ-CCXZUQQUSA-N | |
| 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one | |
| 6253 | |
| 243.22 |
| Glass bottle | |
| 100mg | |
| 97.5% min. (HPLC) | |
| 15,2781 | |
| Solubility in water: soluble. Other solubilities: soluble in dmso, ethanol | |
| C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O | |
| 243.22 | |
| CHEBI:28680 | |
| 98% |
Chemical Identifiers
| 147-94-4 | |
| 243.22 | |
| ara-c, arabinocytidine, arabinosylcytosine, aracytidine, cytarabin, cytarabine, cytarabinoside, cytosar, cytosine arabinoside, tarabine | |
| CHEBI:28680 | |
| C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |
| C9H13N3O5 | |
| UHDGCWIWMRVCDJ-CCXZUQQUSA-N | |
| 6253 | |
| 4-amino-1-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
Causes serious eye irritation.
Suspected of damaging fertility or the unborn child.
Suspected of causing genetic defects.
GHS P Statement
IF ON SKIN: Wash with plenty of soap and water.
Obtain special instructions before use.
Wear protective gloves/protective clothing/eye protection/face protection.
IF exposed or concerned: Get medical advice/attention
GHS Signal Word: Warning
EINECSNumber : 205-705-9