missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Cytochalasin B, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 228090010
Specifications
| Cytochalasin B | |
| Glass bottle | |
| White | |
| 1mg | |
| C29H37NO5 | |
| 15, 2787 | |
| Solubility in water: insoluble. Other solubilities: 10.3 mg/mL acetone - 35.4 mg/mL ethanol (24 c), 371 mg/mL dmso - 492 mg/mL dmf (24 c) | |
| CC1CCCC(C=CC(=O)OC23C(C=CC1)C(C(=C)C(C2C(NC3=O)CC4=CC=CC=C4)C)O)O | |
| 44634701 | |
| Powder |
| Authentic | |
| + 89.00 | |
| 218.0°C to 223.0°C | |
| 14930-96-2 | |
| MFCD00077704 | |
| cytochalasin b, cytochalasin b from helminthosporium dematioideum | |
| GBOGMAARMMDZGR-FFXRSMCQSA-N | |
| 479.6 | |
| 479.6 | |
| ≥98% |
Chemical Identifiers
| 14930-96-2 | |
| 479.6 | |
| GBOGMAARMMDZGR-FFXRSMCQSA-N | |
| 44634701 |
| C29H37NO5 | |
| MFCD00077704 | |
| cytochalasin b, cytochalasin b from helminthosporium dematioideum | |
| CC1CCCC(C=CC(=O)OC23C(C=CC1)C(C(=C)C(C2C(NC3=O)CC4=CC=CC=C4)C)O)O |
Safety and Handling
GHS H Statement
Fatal if inhaled.
Suspected of damaging fertility or the unborn child if inhaled.
Fatal if swallowed.
Fatal in contact with skin.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fresh air and kee
GHS Signal Word: Danger
EINECSNumber : 239-000-2