Learn More
Cytochalasin B, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 228090010
Specifications
| Cytochalasin B | |
| Glass bottle | |
| White | |
| 1mg | |
| C29H37NO5 | |
| 15, 2787 | |
| Solubility in water: insoluble. Other solubilities: 10.3 mg/mL acetone - 35.4 mg/mL ethanol (24 c), 371 mg/mL dmso - 492 mg/mL dmf (24 c) | |
| CC1CCCC(C=CC(=O)OC23C(C=CC1)C(C(=C)C(C2C(NC3=O)CC4=CC=CC=C4)C)O)O | |
| 44634701 | |
| Powder |
| Authentic | |
| + 89.00 | |
| 218.0°C to 223.0°C | |
| 14930-96-2 | |
| MFCD00077704 | |
| cytochalasin b | |
| GBOGMAARMMDZGR-FFXRSMCQSA-N | |
| 479.617 | |
| 479.6 | |
| ≥98% |
Chemical Identifiers
| 14930-96-2 | |
| 479.617 | |
| GBOGMAARMMDZGR-FFXRSMCQSA-N | |
| 44634701 |
| C29H37NO5 | |
| MFCD00077704 | |
| cytochalasin b | |
| CC1CCCC(C=CC(=O)OC23C(C=CC1)C(C(=C)C(C2C(NC3=O)CC4=CC=CC=C4)C)O)O |
Safety and Handling
GHS H Statement:
Fatal if inhaled.
Suspected of causing cancer.
Fatal if swallowed.
Fatal in contact with skin.
GHS P Statement:
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
Remove/Take off immediately all contaminated clothing.
IF ON SKIN: Gently wash with plenty of soap and water.
Immediately call a POISON CENTER or doctor/physician.
Use personal protective equipment as required.
IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing.
WARNING: The information provided on this web site was developed in compliance with European Union (EU) regulations and is correct to the best of our knowledge, information and belief at the date of its publication. The information given is designed only as a guide for safe handling and use. It is not to be considered as either a warranty or quality specification.
GHS Signal Word: Danger