missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Specifications
| Curcumin (Natural) | |
| 183°C | |
| MFCD00008365 | |
| curcumin, diferuloylmethane, natural yellow 3, turmeric yellow, turmeric, curcuma, kacha haldi, gelbwurz, halad, curcumin i | |
| COC1=CC(\C=C\C(\O)=C\C(=O)\C=C\C2=CC=C(O)C(OC)=C2)=CC=C1O | |
| 368.39 | |
| CHEBI:3962 | |
| Crystalline Powder |
| 458-37-7 | |
| C21H20O6 | |
| 1 g | |
| ZIUSSTSXXLLKKK-KOBPDPAPSA-N | |
| (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one | |
| 969516 | |
| 368.39 |
Chemical Identifiers
| 458-37-7 | |
| 368.39 | |
| ZIUSSTSXXLLKKK-KOBPDPAPSA-N | |
| 969516 | |
| (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,4,6-trien-3-one |
| C21H20O6 | |
| MFCD00008365 | |
| curcumin, diferuloylmethane, natural yellow 3, turmeric yellow, turmeric, curcuma, kacha haldi, gelbwurz, halad, curcumin i | |
| CHEBI:3962 | |
| COC1=CC(\C=C\C(\O)=C\C(=O)\C=C\C2=CC=C(O)C(OC)=C2)=CC=C1O |
Safety and Handling
RTECSNumber : MI5230000
TSCA : Yes