missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Creatine phosphate, disodium salt, 99.12%, MP Biomedicals™
Manufacturer: MP Biochemicals LLC 0210052025
Specifications
| Creatine phosphate, disodium salt | |
| 25g | |
| 98-100% | |
| creatine phosphate sodium salt | |
| CN(CC(=O)O)C(=NP(=O)(O)O)N.[Na].[Na] | |
| 257.093 | |
| 327.2 |
| White | |
| 922-32-7 | |
| C4H10N3Na2O5P | |
| SLKASYREERFQJJ-UHFFFAOYSA-N | |
| 2-[methyl-[(E)-N'-phosphonocarbamimidoyl]amino]acetic acid;sodium | |
| 131887655 | |
| Crystalline Powder |
Chemical Identifiers
| 922-32-7 | |
| 257.093 | |
| creatine phosphate sodium salt | |
| 2-[methyl-[(E)-N'-phosphonocarbamimidoyl]amino]acetic acid;sodium |
| C4H10N3Na2O5P | |
| SLKASYREERFQJJ-UHFFFAOYSA-N | |
| 131887655 | |
| CN(CC(=O)O)C(=NP(=O)(O)O)N.[Na].[Na] |
Safety and Handling
Recommended Storage : Store at - 0°C