missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Chlorophenol Red, 0.04% Aqueous, pH 5.2 to 6.8 Yellow to Red, Certified, LabChem™
Supplier: LabChem LC130802
Specifications
| Chlorophenol Red | |
| 123333-64-2,7732-18-5 | |
| C19H11Cl2O5S | |
| MFCD00151199 | |
| Passes Test | |
| OC1=CC=C(C=C1Cl)C(=C1/C=CC(=O)C(Cl)=C1)\C1=CC=CC=C1S([O-])(=O)=O | |
| 422.25 | |
| 445.25 | |
| Amber Glass | |
| Red | |
| Liquid |
| 0.04% Aqueous, pH 5.2 to 6.8 Yellow to Red | |
| 99.96,0.04 | |
| C19H11Cl2O5SNa | |
| Soluble in water | |
| QXTPRQZMDKBTAI-UNOMPAQXSA-M | |
| 2-[(3-chloro-4-hydroxyphenyl)[(1Z)-3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene]methyl]benzene-1-sulfonate | |
| 131846007 | |
| Certified | |
| Hydrogen chloride; Carbon monoxide; Carbon dioxide | |
| 1 L |
Chemical Identifiers
| 123333-64-2 | |
| 422.25 | |
| QXTPRQZMDKBTAI-UNOMPAQXSA-M | |
| 2-[(3-chloro-4-hydroxyphenyl)[(1Z)-3-chloro-4-oxocyclohexa-2,5-dien-1-ylidene]methyl]benzene-1-sulfonate |
| C19H11Cl2O5S | |
| MFCD00151199 | |
| 131846007 | |
| OC1=CC=C(C=C1Cl)C(=C1/C=CC(=O)C(Cl)=C1)\C1=CC=CC=C1S([O-])(=O)=O |
Safety and Handling
GHS H Statement
Solution is not hazardous.
GHS P Statement
If in contact with skin or eyes, rinse thoroughly with water for 15-20 minutes.
If swallowed, get medical attention.
Recommended Storage : Room Temperature