missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Specifications
| Chalcone | |
| 57°C | |
| 348°C | |
| MFCD00003082 | |
| chalcone, trans-chalcone, e-chalcone, benzalacetophenone, chalkone, benzylideneacetophenone, phenyl styryl ketone, cinnamophenone, 2-benzalacetophenone, 2-benzylideneacetophenone | |
| O=C(\C=C\C1=CC=CC=C1)C1=CC=CC=C1 | |
| 208.26 | |
| CHEBI:48965 | |
| ≥98.0% (GC) |
| 94-41-7 | |
| Yellow | |
| C15H12O | |
| 100 g | |
| DQFBYFPFKXHELB-VAWYXSNFSA-N | |
| (2E)-1,3-diphenylprop-2-en-1-one | |
| 637760 | |
| 208.26 | |
| Crystalline Powder |
Chemical Identifiers
| 94-41-7 | |
| 208.26 | |
| DQFBYFPFKXHELB-VAWYXSNFSA-N | |
| 637760 | |
| (2E)-1,3-diphenylprop-2-en-1-one |
| C15H12O | |
| MFCD00003082 | |
| chalcone, trans-chalcone, e-chalcone, benzalacetophenone, chalkone, benzylideneacetophenone, phenyl styryl ketone, cinnamophenone, 2-benzalacetophenone, 2-benzylideneacetophenone | |
| CHEBI:48965 | |
| O=C(\C=C\C1=CC=CC=C1)C1=CC=CC=C1 |
Safety and Handling
EINECSNumber : (4)-0073
RTECSNumber : FL6900000
TSCA : Yes