missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carboxymethylecellulose, sodium salt, average M.W. 90000 (DS=0.7), ACROS Organics™
$58.03 - $553.38
Chemical Identifiers
| CAS | 9004-32-4 |
|---|---|
| Molecular Formula | C8H15NaO8 |
| Molecular Weight (g/mol) | 262.19 |
| MDL Number | MFCD00081472 |
| InChI Key | QMGYPNKICQJHLN-UHFFFAOYSA-M |
| Synonym | c.m.c. tn |
| PubChem CID | 23706213 |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
| SMILES | CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
| AC332601000 SDS |
Acros Organics
332601000 |
100g | Glass bottle |
Each for $58.03
|
|
AC332600010 SDS |
Acros Organics
332600010 |
1kg | Glass bottle |
Each for $140.13
|
|
AC332600050 SDS |
Acros Organics
AC332600050 |
5kg | Plastic drum |
Each for $553.38
|
|
Chemical Identifiers
| 9004-32-4 | |
| 262.19 | |
| QMGYPNKICQJHLN-UHFFFAOYSA-M | |
| 23706213 | |
| CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| C8H15NaO8 | |
| MFCD00081472 | |
| c.m.c. tn | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
Specifications
| 9004-32-4 | |
| 1ppm max. | |
| 0.65 to 0.90 | |
| 20ppm max. | |
| QMGYPNKICQJHLN-UHFFFAOYSA-M | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
| 23706213 | |
| Granular Powder | |
| ≥99.5% | |
| 10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
| < 0.25% | |
| 50-100 mPa.s 2% sol. | |
| >300.0°C | |
| 100g |
| 3ppm max. | |
| C8H15NaO8 | |
| MFCD00081472 | |
| c.m.c. tn | |
| CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] | |
| 262.19 | |
| Authentic | |
| 10ppm max. | |
| 1ppm max. | |
| Glass bottle | |
| < 0.4% | |
| White to Yellow | |
| 6.5 to 8 (1% soln.) | |
| Carboxymethylecellulose, sodium salt, Average M.W. 90000 (DS=0.7) |