missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carboxymethylecellulose, sodium salt, average M.W. 250000 (DS=1.2), ACROS Organics™
$35.37 - $148.00
Chemical Identifiers
| CAS | 9004-32-4 |
|---|---|
| Molecular Formula | C8H15NaO8 |
| Molecular Weight (g/mol) | 262.19 |
| MDL Number | MFCD00081472 |
| InChI Key | QMGYPNKICQJHLN-UHFFFAOYSA-M |
| Synonym | c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate |
| PubChem CID | 23706213 |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
| SMILES | CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC332631000
|
Thermo Fisher Scientific
332631000 |
100g | Glass bottle |
Each for $35.37
|
|
AC332630010
|
Thermo Fisher Scientific
332630010 |
1kg | Glass bottle |
Each for $148.00
|
|
Chemical Identifiers
| 9004-32-4 | |
| 262.19 | |
| QMGYPNKICQJHLN-UHFFFAOYSA-M | |
| 23706213 | |
| CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| C8H15NaO8 | |
| MFCD00081472 | |
| c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
Specifications
| 9004-32-4 | |
| 3ppm max. | |
| MFCD00081472 | |
| 15, 1830 | |
| QMGYPNKICQJHLN-UHFFFAOYSA-M | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
| 23706213 | |
| Crystalline Powder | |
| ≥99.5% | |
| Glass bottle | |
| White to Beige | |
| 100g |
| degree of substitution: 1.15 to 1.45 | |
| C8H15NaO8 | |
| 20ppm max. | |
| c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
| CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] | |
| 262.19 | |
| Authentic | |
| 10ppm max. | |
| 10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
| 2300mPa·s, 2% sol. | |
| 6.5 to 8 (1% soln.) | |
| Carboxymethylecellulose, sodium salt, Average M.W. 250000 (DS=1.2) |