missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Thermo Scientific™ Carboxymethylecellulose, sodium salt, average M.W. 250000 (DS=1.2)
$35.72 - $160.78
Chemical Identifiers
| CAS | 9004-32-4 |
|---|---|
| Molecular Formula | C8H15NaO8 |
| Molecular Weight (g/mol) | 262.19 |
| MDL Number | MFCD00081472 |
| InChI Key | QMGYPNKICQJHLN-UHFFFAOYSA-M |
| Synonym | c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate |
| PubChem CID | 23706213 |
| IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
| SMILES | CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC332631000
|
Thermo Scientific™
332631000 |
100g | Glass bottle |
Each for $35.72
|
|
AC332630010
|
Thermo Scientific™
332630010 |
1kg | Glass bottle |
Each for $160.78
|
|
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Chemical Identifiers
| 9004-32-4 | |
| 262.19 | |
| QMGYPNKICQJHLN-UHFFFAOYSA-M | |
| 23706213 | |
| CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
| C8H15NaO8 | |
| MFCD00081472 | |
| c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
Specifications
| 9004-32-4 | |
| 3ppm max. | |
| MFCD00081472 | |
| White to Beige | |
| 6.5 to 8 (1% soln.) | |
| QMGYPNKICQJHLN-UHFFFAOYSA-M | |
| sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
| 23706213 | |
| ≥99.5% | |
| Authentic | |
| 10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
| 2300mPa·s, 2% sol. |
| degree of substitution: 1.15 to 1.45 | |
| C8H15NaO8 | |
| 15, 1830 | |
| c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
| 100g | |
| CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] | |
| 262.19 | |
| Crystalline Powder | |
| 20ppm max. | |
| 10ppm max. | |
| Glass bottle | |
| Carboxymethylecellulose, sodium salt, Average M.W. 250000 (DS=1.2) |
RUO – Research Use Only