missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carboxymethylecellulose, sodium salt, average M.W. 250000 (DS=1.2), ACROS Organics™
$35.37 - $148.00
Chemical Identifiers
CAS | 9004-32-4 |
---|---|
Molecular Formula | C8H15NaO8 |
Molecular Weight (g/mol) | 262.19 |
MDL Number | MFCD00081472 |
InChI Key | QMGYPNKICQJHLN-UHFFFAOYSA-M |
Synonym | c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate |
PubChem CID | 23706213 |
IUPAC Name | sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
SMILES | CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
---|---|---|---|---|---|---|---|---|---|
Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
AC332631000
|
Thermo Fisher Scientific
332631000 |
100g | Glass bottle |
Each for $35.37
|
|
AC332630010
|
Thermo Fisher Scientific
332630010 |
1kg | Glass bottle |
Each for $148.00
|
|
Chemical Identifiers
9004-32-4 | |
262.19 | |
QMGYPNKICQJHLN-UHFFFAOYSA-M | |
23706213 | |
CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
C8H15NaO8 | |
MFCD00081472 | |
c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |
Specifications
9004-32-4 | |
3ppm max. | |
MFCD00081472 | |
15, 1830 | |
QMGYPNKICQJHLN-UHFFFAOYSA-M | |
sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
23706213 | |
Crystalline Powder | |
≥99.5% | |
Glass bottle | |
White to Beige | |
100g |
degree of substitution: 1.15 to 1.45 | |
C8H15NaO8 | |
20ppm max. | |
c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] | |
262.19 | |
Authentic | |
10ppm max. | |
10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
2300mPa·s, 2% sol. | |
6.5 to 8 (1% soln.) | |
Carboxymethylecellulose, sodium salt, Average M.W. 250000 (DS=1.2) |