missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carboxymethylecellulose, sodium salt, average M.W. 250000 (DS=0.9), ACROS Organics™
Manufacturer: Thermo Fisher Scientific 332620010
Specifications
Carboxymethylecellulose, sodium salt | |
9004-32-4 | |
1ppm max. | |
0.80 to 0.95 | |
10ppm max. | |
c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] | |
262.19 | |
Authentic | |
3ppm max. | |
1ppm max. | |
Glass bottle | |
< 0.4% | |
White to Beige | |
1kg |
Average M.W. 250000 (DS=0.9) | |
3ppm max. | |
C8H15NaO8 | |
MFCD00081472 | |
15, 1830 | |
QMGYPNKICQJHLN-UHFFFAOYSA-M | |
sodium;2,3,4,5,6-pentahydroxyhexanal;acetate | |
23706213 | |
Crystalline Powder | |
≥99.5% | |
10% max. (as packed) (3 to 5 g, 105°C, 2 hrs) | |
< 0.25% | |
2300mPa·s, 2% sol. | |
6.5 to 8 (1% soln.) |
Chemical Identifiers
9004-32-4 | |
262.19 | |
QMGYPNKICQJHLN-UHFFFAOYSA-M | |
23706213 | |
CC(=O)[O-].C(C(C(C(C(C=O)O)O)O)O)O.[Na+] |
C8H15NaO8 | |
MFCD00081472 | |
c.m.c. tn, carboxymethylcellulose sodium usp, carmellose sodium jp17, celluvisc tn, sodium dextrose acetate | |
sodium;2,3,4,5,6-pentahydroxyhexanal;acetate |