missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Carbonyl cyanide 3-chlorophenylhydrazone, 98%, ACROS Organics™
$43.79 - $235.35
Chemical Identifiers
| CAS | 555-60-2 |
|---|---|
| Molecular Formula | C9H5ClN4 |
| Molecular Weight (g/mol) | 204.62 |
| MDL Number | MFCD00001848 |
| InChI Key | UGTJLJZQQFGTJD-UHFFFAOYSA-N |
| Synonym | 3-chlorophenyl hydrazono malononitrile, 3-chlorophenyl hydrazonomalononitrile, carbonyl cyanide 3-chlorophenylhydrazone, carbonyl cyanide m-chlorophenyl hydrazone, carbonyl cyanide m-chlorophenylhydrazone, carbonyl cyanide, 3-chlorophenyl hydrazone, carbonylcyanide-3-chlorophenylhydrazone, cccp, m-chlorophenyl carbonylcyanide hydrazone, m-cl-ccp |
| PubChem CID | 2603 |
| ChEBI | CHEBI:3259 |
| IUPAC Name | 2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile |
| SMILES | C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC228131000
|
Thermo Fisher Scientific
228131000 |
100mg | Glass bottle |
Each for $43.79
|
|
AC228130010
|
Thermo Fisher Scientific
228130010 |
1g | Glass bottle |
Each for $235.35
|
|
Chemical Identifiers
| 555-60-2 | |
| 204.62 | |
| UGTJLJZQQFGTJD-UHFFFAOYSA-N | |
| 2603 | |
| 2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile |
| C9H5ClN4 | |
| MFCD00001848 | |
| 3-chlorophenyl hydrazono malononitrile, 3-chlorophenyl hydrazonomalononitrile, carbonyl cyanide 3-chlorophenylhydrazone, carbonyl cyanide m-chlorophenyl hydrazone, carbonyl cyanide m-chlorophenylhydrazone, carbonyl cyanide, 3-chlorophenyl hydrazone, carbonylcyanide-3-chlorophenylhydrazone, cccp, m-chlorophenyl carbonylcyanide hydrazone, m-cl-ccp | |
| CHEBI:3259 | |
| C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N |
Specifications
| Authentic | |
| Undesignated | |
| 100mg | |
| 97.5% min. (HPLC) | |
| ClC6H4NHN=C(CN)2 | |
| 3-chlorophenyl hydrazono malononitrile, 3-chlorophenyl hydrazonomalononitrile, carbonyl cyanide 3-chlorophenylhydrazone, carbonyl cyanide m-chlorophenyl hydrazone, carbonyl cyanide m-chlorophenylhydrazone, carbonyl cyanide, 3-chlorophenyl hydrazone, carbonylcyanide-3-chlorophenylhydrazone, cccp, m-chlorophenyl carbonylcyanide hydrazone, m-cl-ccp | |
| UGTJLJZQQFGTJD-UHFFFAOYSA-N | |
| 2-[(3-chlorophenyl)hydrazinylidene]propanedinitrile | |
| 2603 | |
| 204.62 | |
| 98% |
| Glass bottle | |
| 172°C to 177°C | |
| 555-60-2 | |
| C9H5ClN4 | |
| MFCD00001848 | |
| Solubility in water: insoluble | |
| C1=CC(=CC(=C1)Cl)NN=C(C#N)C#N | |
| 204.62 | |
| CHEBI:3259 | |
| Crystalline Powder | |
| Carbonyl cyanide 3-chlorophenylhydrazone, 99+% |
Safety and Handling
GHS H Statement
Toxic if swallowed.
Toxic if inhaled.
Toxic in contact with skin.
Causes skin irritation.
Causes serious eye irritation.
May cause respiratory irritation.
GHS P Statement
IF SWALLOWED: Immediately call a POISON CENTER or doctor/physician.
Wear protective gloves/protective clothing/eye protection/face protection.
IF ON SKIN: Wash with plenty of soap and water.
IF INHALED: Remove to fre
GHS Signal Word: Danger
EINECSNumber : 209-103-7
RTECSNumber : FG5600000
TSCA : TSCA