missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Organic Carbon Standard, 1000 ppm C, Ricca Chemical
Supplier: Ricca Chemical Company 184725
Specifications
| Organic Carbon Standard | |
| Cubitainer | |
| 97.0,0.46,0.21 | |
| Colorless | |
| C8H5KO4 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] | |
| 204.222 | |
| 1 mL = 1 mg C |
| 877-24-7,7664-38-2,877-24-7,7732-18-5 | |
| 10 L | |
| 100.0,0.48,0.22 | |
| 1000ppm | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate | |
| 23676735 | |
| Liquid |
Chemical Identifiers
| 877-24-7 | |
| 204.222 | |
| 23676735 | |
| C1=CC=C(C(=C1)C(=O)O)C(=O)[O-].[K+] |
| C8H5KO4 | |
| IWZKICVEHNUQTL-UHFFFAOYSA-M | |
| potassium;2-carboxybenzoate |