missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
BOC-L-Tyrosine, 99+%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 275700250
Specifications
| BOC-L-Tyrosine | |
| 99+% | |
| HOC6H4CH2CH(COOH)NHCO2C(CH3)3 | |
| MFCD00037179 | |
| Glass bottle | |
| CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)O | |
| 281.308 | |
| 281.3 | |
| Powder | |
| 1% Max. (K.F.) | |
| 135.0°C to 140.0°C |
| 3978-80-1 | |
| C14H19NO5 | |
| Authentic | |
| boc-l-tyrosine, boc-tyr-oh, chembl65386, l-tyrosine, n-1,1-dimethylethoxy carbonyl, n-boc-l-tyrosine, n-boc-tyrosine, n-t-boc-l-tyrosine, n-t-butoxycarbonyl-l-tyrosine, n-tert-butoxycarbonyl tyrosine, n-tert-butoxycarbonyl-l-tyrosine | |
| CNBUSIJNWNXLQQ-NSHDSACASA-N | |
| (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid | |
| 117439 | |
| + 2.50 | |
| ≥99% | |
| White | |
| 25g |
Chemical Identifiers
| 3978-80-1 | |
| 281.308 | |
| CNBUSIJNWNXLQQ-NSHDSACASA-N | |
| 117439 | |
| CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)O)C(=O)O |
| C14H19NO5 | |
| MFCD00037179 | |
| boc-l-tyrosine, boc-tyr-oh, chembl65386, l-tyrosine, n-1,1-dimethylethoxy carbonyl, n-boc-l-tyrosine, n-boc-tyrosine, n-t-boc-l-tyrosine, n-t-butoxycarbonyl-l-tyrosine, n-tert-butoxycarbonyl tyrosine, n-tert-butoxycarbonyl-l-tyrosine | |
| (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |