missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
BOC-L-Serine hydrate, 98%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 275660050
Specifications
| BOC-L-Serine hydrate | |
| 98% | |
| HOCH2CH(COOH)NHCOOC(CH3)3· | |
| MFCD00150501 | |
| Glass bottle | |
| CC(C)(C)OC(=O)NC(CO)C(=O)O | |
| 205.21 | |
| 205.21 | |
| Powder | |
| Technical | |
| White | |
| 5g |
| 3262-72-4 | |
| C8H15NO5 | |
| Authentic | |
| boc-l-ser, boc-l-serine, boc-ser-oh, n-boc-l-serine, n-boc-serine, n-t-butoxycarbonyl-l-serine, n-tert-butoxycarbonyl serine, n-tert-butoxycarbonyl-l-serine, s-2-tert-butoxycarbonyl amino-3-hydroxypropanoic acid, s-n-boc-serine | |
| FHOAKXBXYSJBGX-YFKPBYRVSA-N | |
| (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid | |
| 98766 | |
| − 8.10 | |
| 98% | |
| 7.5 to 8.0% (K.F.) | |
| 84.0°C to 89.0°C | |
| 186°C |
Chemical Identifiers
| 3262-72-4 | |
| 205.21 | |
| FHOAKXBXYSJBGX-YFKPBYRVSA-N | |
| 98766 | |
| CC(C)(C)OC(=O)NC(CO)C(=O)O |
| C8H15NO5 | |
| MFCD00150501 | |
| boc-l-ser, boc-l-serine, boc-ser-oh, n-boc-l-serine, n-boc-serine, n-t-butoxycarbonyl-l-serine, n-tert-butoxycarbonyl serine, n-tert-butoxycarbonyl-l-serine, s-2-tert-butoxycarbonyl amino-3-hydroxypropanoic acid, s-n-boc-serine | |
| (2S)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |