missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
BOC-L-Methionine, +99%, ACROS Organics™
Manufacturer: Thermo Fisher Scientific 275630250
Specifications
| BOC-L-Methionine | |
| 2488-15-5 | |
| C10H19NO4S | |
| Authentic | |
| boc-l-methionine, boc-met-oh, l-methionine, n-1,1-dimethylethoxy carbonyl, methionine, n-1,1-dimethylethoxy carbonyl, n-alpha-t-butyloxycarbonyl-l-methionine, n-boc-l-methionine, n-tert-butoxycarbonyl-l-methionine, s-2-tert-butoxycarbonyl amino-4-methylthio butanoic acid, tert-butoxycarbonyl-l-methionine | |
| IMUSLIHRIYOHEV-ZETCQYMHSA-N | |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid | |
| 89857 | |
| − 23.00 | |
| ≥99% | |
| White | |
| 25g |
| 99+% | |
| 99+% | |
| CH3SCH2CH2CH(COOH)NHCOOC(CH3)3 | |
| MFCD00065586 | |
| Glass bottle | |
| CC(C)(C)OC(=O)NC(CCSC)C(=O)O | |
| 249.325 | |
| 249.33 | |
| Powder | |
| 0.5% max. (K.F.) | |
| 47.0°C to 53.0°C |
Chemical Identifiers
| 2488-15-5 | |
| 249.325 | |
| IMUSLIHRIYOHEV-ZETCQYMHSA-N | |
| 89857 | |
| CC(C)(C)OC(=O)NC(CCSC)C(=O)O |
| C10H19NO4S | |
| MFCD00065586 | |
| boc-l-methionine, boc-met-oh, l-methionine, n-1,1-dimethylethoxy carbonyl, methionine, n-1,1-dimethylethoxy carbonyl, n-alpha-t-butyloxycarbonyl-l-methionine, n-boc-l-methionine, n-tert-butoxycarbonyl-l-methionine, s-2-tert-butoxycarbonyl amino-4-methylthio butanoic acid, tert-butoxycarbonyl-l-methionine | |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfanylbutanoic acid |
Safety and Handling
EINECSNumber : 219-639-3